Feedback

amidinoproclavaminate

Properties
MNX_IDMNXM1811
formulaC9H16N4O4
charge0
mass244.2479
referencechebi:58647
Image of MNXM1811
InChIKeyMPNWPLYZGCKKFY-VDTYLAMSSA-N
InChIInChI=1S/C9H16N4O4/c10-9(11)12-3-1-5(14)7(8(16)17)13-4-2-6(13)15/h5,7,14H,1-4H2,(H,16,17)(H4,10,11,12)/t5-,7+/m1/s1
SMILESNC(=[NH2+])NCC[C@@H](O)[C@H](N1CCC1=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:58647 amidinoproclavaminate
(2S,3R)-5-{[amino(iminiumyl)methyl]amino}-3-hydroxy-2-(2-oxoazetidin-1-yl)pentanoate
amidinoproclavaminic acid zwitterion
chebi:32963 amidinoproclavaminic acid
(2S,3R)-5-carbamimidamido-3-hydroxy-2-(2-oxoazetidin-1-yl)pentanoic acid
Amidinoproclavaminate
Guanidinoproclavaminate
Guanidinoproclavaminic acid
chebi:13765
chebi:5562
keggC:M_C06657
seedM:M_cpd04060
secondary/obsolete/fantasy identifier
seedM:cpd04060 Amidinoproclavaminate
Guanidinoproclavaminate
Guanidinoproclavaminic acid
amidinoproclavaminate
guanidinoproclavaminic acid
keggC:C06657 Guanidinoproclavaminic acid
Amidinoproclavaminate
Guanidinoproclavaminate
metacycM:AMIDINOPROCLAVAMINATE amidinoproclavaminate
guanidinoproclavaminic acid