Feedback

D-glutamine

Properties
MNX_IDMNXM1819
formulaC5H10N2O3
charge0
mass146.14458
referencechebi:58000
Image of MNXM1819
InChIKeyZDXPYRJPNDTMRX-GSVOUGTGSA-N
InChIInChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m1/s1
SMILESNC(=O)CC[C@@H]([NH3+])C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref12
Distinct compatimentalized reactions in models1

Similar chemical compounds in external resources
IdentifierDescription
keggC:C00819
sabiorkM:2165
D-Glutamine
D-2-Aminoglutaramic acid
chebi:32673 D-glutaminium
(1R)-4-amino-1-carboxy-4-oxobutan-1-aminium
D-glutamine cation
seedM:cpd00610 D-Glutamine
D-2-Aminoglutaramic acid
D-glutamine
glutamide
chebi:32672 D-glutaminate
(2R)-2,5-diamino-5-oxopentanoate
D-glutamine anion
chebi:12980
chebi:21024
chebi:4184
hmdb:HMDB03423
keggC:M_C00819
seedM:M_cpd00610
secondary/obsolete/fantasy identifier
chebi:17061 D-glutamine
(2R)-2,5-diamino-5-oxopentanoic acid
(2R)-2-amino-4-carbamoylbutanoic acid
(R)-2,5-diamino-5-oxopentanoic acid
D-2-Aminoglutaramic acid
D-Glutamin
D-Glutamine
D-Glutaminsaeure-5-amid
DGN
chebi:58000 D-glutamine
(2R)-5-amino-2-ammonio-5-oxopentanoate
(2R)-5-amino-2-azaniumyl-5-oxopentanoate
D-glutamine zwitterion
metacycM:GLUTAMIDE D-glutamine
glutamide
hmdb:HMDB0003423 D-Glutamine
(2R)-2,5-diamino-5-Oxopentanoate
(2R)-2,5-diamino-5-Oxopentanoic acid
(2R)-2-amino-4-Carbamoylbutanoate
(2R)-2-amino-4-Carbamoylbutanoic acid
(2R)-2-amino-4-carbamoylbutanoic acid
(R)-2,5-diamino-5-Oxopentanoate
(R)-2,5-diamino-5-Oxopentanoic acid
D Glutamine
D-2-Aminoglutaramate
D-2-Aminoglutaramic acid
D-Glutamin
D-Glutaminsaeure-5-amid
D-glutamine
DGN
Glutamine
L Glutamine
L-Glutamine
Nutrestore