Feedback

germacra-1(10),4,11(13)-trien-12-oate

PropertiesImageOccurences in reactions
MNX_IDMNXM1830Image of MNXM1830
#reac
in my sandbox 0
in MNXref (generic)30
in models (compartimentalized) 0
formulaC15H21O2
charge-1
mass233.32604
referencechebi:61301
InChIKeyIBJVPIJUFFVDBS-JBMXZMKISA-M
InChIInChI=1S/C15H22O2/c1-11-5-4-6-12(2)8-10-14(9-7-11)13(3)15(16)17/h5,8,14H,3-4,6-7,9-10H2,1-2H3,(H,16,17)/p-1/b11-5+,12-8+/t14-/m1/s1
SMILESC\C1=C/C[C@@H](CC\C(C)=C\CC1)C(=C)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:61301
chebi:61301
germacra-1(10),4,11(13)-trien-12-oate
2-[(1R,3E,7E)-4,8-dimethylcyclodeca-3,7-dien-1-yl]prop-2-enoate
germacrene acid anion
kegg.compound:C19678
keggC:C19678
Germacrene A acid
Germacra-1(10),4,11(13)-trien-12-oate
seed.compound:cpd20926
seedM:cpd20926
Germacrene A acid
Germacra-1(10),4,11(13)-trien-12-oate
germacra-1(10),4,11(13)-trien-12-oate
germacra-1(10),4,11(13)-trien-12-oic acid
germacrene acid
metacyc.compound:CPD-9413
metacycM:CPD-9413
germacra-1(10),4,11(13)-trien-12-oate
germacra-1(10),4,11(13)-trien-12-oic acid
germacrene acid
CHEBI:61305
chebi:61305
germacra-1(10),4,11(13)-trien-12-oic acid
2-[(1R,3E,7E)-4,8-dimethylcyclodeca-3,7-dien-1-yl]prop-2-enoic acid
germacrene acid
keggC:M_C19678
seedM:M_cpd20926
secondary/obsolete/fantasy identifier