Feedback

germacra-1(10),4,11(13)-trien-12-oate

Properties
MNX_IDMNXM1830
formulaC15H21O2
charge-1
mass233.32604
referencechebi:61301
Image of MNXM1830
InChIKeyIBJVPIJUFFVDBS-JBMXZMKISA-M
InChIInChI=1S/C15H22O2/c1-11-5-4-6-12(2)8-10-14(9-7-11)13(3)15(16)17/h5,8,14H,3-4,6-7,9-10H2,1-2H3,(H,16,17)/p-1/b11-5+,12-8+/t14-/m1/s1
SMILESC\C1=C/C[C@@H](CC\C(C)=C\CC1)C(=C)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref30
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:61305 germacra-1(10),4,11(13)-trien-12-oic acid
2-[(1R,3E,7E)-4,8-dimethylcyclodeca-3,7-dien-1-yl]prop-2-enoic acid
germacrene acid
metacycM:CPD-9413 germacra-1(10),4,11(13)-trien-12-oate
germacra-1(10),4,11(13)-trien-12-oic acid
germacrene acid
seedM:cpd20926 Germacrene A acid
Germacra-1(10),4,11(13)-trien-12-oate
germacra-1(10),4,11(13)-trien-12-oate
germacra-1(10),4,11(13)-trien-12-oic acid
germacrene acid
chebi:61301 germacra-1(10),4,11(13)-trien-12-oate
2-[(1R,3E,7E)-4,8-dimethylcyclodeca-3,7-dien-1-yl]prop-2-enoate
germacrene acid anion
keggC:M_C19678
seedM:M_cpd20926
secondary/obsolete/fantasy identifier
keggC:C19678 Germacrene A acid
Germacra-1(10),4,11(13)-trien-12-oate