Feedback

proclavaminate

PropertiesImageOccurences in reactions
MNX_IDMNXM1852Image of MNXM1852
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC8H14N2O4
charge0
mass202.20784
referencechebi:57302
InChIKeyNMCINKPVAOXDJH-VDTYLAMSSA-N
InChIInChI=1S/C8H14N2O4/c9-3-1-5(11)7(8(13)14)10-4-2-6(10)12/h5,7,11H,1-4,9H2,(H,13,14)/t5-,7+/m1/s1
SMILES[NH3+]CC[C@@H](O)[C@H](N1CCC1=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57302
chebi:57302
proclavaminate
(2S,3R)-5-azaniumyl-3-hydroxy-2-(2-oxoazetidin-1-yl)pentanoate
5-azaniumyl-2,4,5-trideoxy-2-(2-oxoazetidin-1-yl)-D-threo-pentonate
proclavaminic acid zwitterion
seed.compound:cpd04061
seedM:cpd04061
Proclavaminate
Proclavaminic acid
proclavaminate
kegg.compound:C06658
keggC:C06658
Proclavaminic acid
Proclavaminate
metacyc.compound:PROCLAVAMINATE
metacycM:PROCLAVAMINATE
proclavaminate
CHEBI:15425
chebi:15425
proclavaminic acid
(2S,3R)-5-amino-3-hydroxy-2-(2-oxoazetidin-1-yl)pentanoic acid
5-AMINO-3-HYDROXY-2-(2-OXO-AZETIDIN-1-YL)-PENTANOIC ACID
5-amino-2,4,5-trideoxy-2-(2-oxo-1-azetidinyl)-D-threo-pentonic acid
5-amino-2,4,5-trideoxy-2-(2-oxoazetidin-1-yl)-D-threo-pentonic acid
Proclavaminate
Proclavaminic acid
chebi:12883
chebi:14888
chebi:44967
chebi:8437
keggC:M_C06658
seedM:M_cpd04061
secondary/obsolete/fantasy identifier