Feedback

proclavaminate

Properties
MNX_IDMNXM1852
formulaC8H14N2O4
charge0
mass202.20784
referencechebi:57302
Image of MNXM1852
InChIKeyNMCINKPVAOXDJH-VDTYLAMSSA-N
InChIInChI=1S/C8H14N2O4/c9-3-1-5(11)7(8(13)14)10-4-2-6(10)12/h5,7,11H,1-4,9H2,(H,13,14)/t5-,7+/m1/s1
SMILES[NH3+]CC[C@@H](O)[C@H](N1CCC1=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:15425 proclavaminic acid
(2S,3R)-5-amino-3-hydroxy-2-(2-oxoazetidin-1-yl)pentanoic acid
5-AMINO-3-HYDROXY-2-(2-OXO-AZETIDIN-1-YL)-PENTANOIC ACID
5-amino-2,4,5-trideoxy-2-(2-oxo-1-azetidinyl)-D-threo-pentonic acid
5-amino-2,4,5-trideoxy-2-(2-oxoazetidin-1-yl)-D-threo-pentonic acid
Proclavaminate
Proclavaminic acid
metacycM:PROCLAVAMINATE proclavaminate
keggC:C06658 Proclavaminic acid
Proclavaminate
chebi:57302 proclavaminate
(2S,3R)-5-azaniumyl-3-hydroxy-2-(2-oxoazetidin-1-yl)pentanoate
5-azaniumyl-2,4,5-trideoxy-2-(2-oxoazetidin-1-yl)-D-threo-pentonate
proclavaminic acid zwitterion
chebi:12883
chebi:14888
chebi:44967
chebi:8437
keggC:M_C06658
seedM:M_cpd04061
secondary/obsolete/fantasy identifier
seedM:cpd04061 Proclavaminate
Proclavaminic acid
proclavaminate