Feedback

2-formylbenzoate

Properties
MNX_IDMNXM1883
formulaC8H5O3
charge-1
mass149.1235
referencechebi:58203
Image of MNXM1883
InChIKeyDYNFCHNNOHNJFG-UHFFFAOYSA-M
InChIInChI=1S/C8H6O3/c9-5-6-3-1-2-4-7(6)8(10)11/h1-5H,(H,10,11)/p-1
SMILES[O-]C(=O)c1ccccc1C=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
envipath:...6b2dcd8e7732 compound 42662
chebi:17605 2-formylbenzoic acid
2-Carboxybenzaldehyde
2-Formylbenzoic acid
Phthalaldehydic acid
o-Formylbenzoic acid
o-formylbenzoic acid
chebi:1037
chebi:11538
chebi:19497
keggC:M_C03057
seedM:M_cpd01956
secondary/obsolete/fantasy identifier
sabiorkM:2643 2-Carboxybenzaldehyde
Phthalaldehydic acid
o-Formylbenzoic acid
envipath:...d9ff3a3279a7 2-Carboxybenzaldehyde
seedM:cpd01956 o-Formylbenzoic acid
2-Carboxybenzaldehyde
2-Formylbenzoate
2-Formylbenzoic acid
2-carboxybenzaldehyde
2-formylbenzoate
Phthalaldehydic acid
o-formylbenzoate
o-formylbenzoic acid
phthalaldehydic acid
chebi:58203 2-formylbenzoate
2-carboxylatobenzaldehyde
2-formylbenzoate anion
2-formylbenzoate(1-)
metacycM:CPD-1131 2-formylbenzoate
2-carboxybenzaldehyde
o-formylbenzoate
o-formylbenzoic acid
phthalaldehydic acid
keggC:C03057 2-Carboxybenzaldehyde
2-Formylbenzoate
2-Formylbenzoic acid
Phthalaldehydic acid
o-Formylbenzoic acid
MNXM724272is deprecated and replaced by this entry