Feedback

2-formylbenzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1883Image of MNXM1883
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 0
formulaC8H5O3
charge-1
mass149.02442
referencechebi:58203
InChIKeyDYNFCHNNOHNJFG-UHFFFAOYSA-M
InChIInChI=1S/C8H6O3/c9-5-6-3-1-2-4-7(6)8(10)11/h1-5H,(H,10,11)/p-1
SMILESO=Cc1ccccc1C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58203
chebi:58203
2-formylbenzoate
2-carboxylatobenzaldehyde
2-formylbenzoate anion
2-formylbenzoate(1-)
envipath:...d9ff3a3279a7
envipathM:...d9ff3a3279a7
2-Carboxybenzaldehyde
kegg.compound:C03057
keggC:C03057
2-Carboxybenzaldehyde
2-Formylbenzoate
2-Formylbenzoic acid
Phthalaldehydic acid
o-Formylbenzoic acid
sabiork.compound:2643
sabiorkM:2643
2-Carboxybenzaldehyde
Phthalaldehydic acid
o-Formylbenzoic acid
metacyc.compound:CPD-1131
metacycM:CPD-1131
2-formylbenzoate
2-carboxybenzaldehyde
o-formylbenzoate
o-formylbenzoic acid
phthalaldehydic acid
CHEBI:17605
chebi:17605
2-formylbenzoic acid
2-Carboxybenzaldehyde
2-Formylbenzoic acid
Phthalaldehydic acid
o-Formylbenzoic acid
o-formylbenzoic acid
envipath:...6b2dcd8e7732
envipathM:...6b2dcd8e7732
compound 42662
seed.compound:cpd01956
seedM:cpd01956
o-Formylbenzoic acid
2-Carboxybenzaldehyde
2-Formylbenzoate
2-Formylbenzoic acid
2-carboxybenzaldehyde
2-formylbenzoate
Phthalaldehydic acid
o-formylbenzoate
o-formylbenzoic acid
phthalaldehydic acid
chebi:1037
chebi:11538
chebi:19497
keggC:M_C03057
seedM:M_cpd01956
secondary/obsolete/fantasy identifier