Feedback

3-(3,4-dihydroxyphenyl)pyruvate

PropertiesImageOccurences in reactions
MNX_IDMNXM1887Image of MNXM1887
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 2
formulaC9H7O5
charge-1
mass195.0299
referencechebi:29055
InChIKeyLQQFFJFGLSKYIR-UHFFFAOYSA-M
InChIInChI=1S/C9H8O5/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,10-11H,4H2,(H,13,14)/p-1
SMILESO=C([O-])C(=O)Cc1ccc(O)c(O)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:29055
chebi:29055
3-(3,4-dihydroxyphenyl)pyruvate
3,4-dihydroxyphenylpyruvate
3-(3,4-dihydroxyphenyl)-2-oxopropanoate
sabiork.compound:30967
sabiorkM:30967
3,4-Dihydroxyphenylpyruvate
CHEBI:19891
chebi:19891
3,4-dihydroxyphenylpyruvic acid
3,4-Dihydroxyphenylpyruvate
3,4-dihydroxy-alpha-oxobenzenepropanoic acid
3-(3,4-dihydroxyphenyl)-2-oxopropanoic acid
DHPPA
sabiork.compound:7039
sabiorkM:7039
3-(3,4-Dihydroxyphenyl)pyruvate
kegg.compound:C04045
keggC:C04045
3-(3,4-Dihydroxyphenyl)pyruvate
3,4-Dihydroxyphenylpyruvate
seed.compound:cpd02502
seedM:cpd02502
3-(3,4-Dihydroxyphenyl)pyruvate
3,4-Dihydroxyphenylpyruvate
3,4-dihydroxyphenylpyruvate
3-(3,4-dihydroxyphenyl)-2-oxo-propanoic acid
3-(3,4-dihydroxyphenyl)pyruvate
hmdb:HMDB0125373 3-(3,4-dihydroxyphenyl)-2-oxopropanoic acid
3,4-Dihydroxy-a-oxobenzenepropanoate
3,4-Dihydroxy-a-oxobenzenepropanoic acid
3,4-Dihydroxy-alpha-oxobenzenepropanoate
3,4-Dihydroxy-alpha-oxobenzenepropanoic acid
3,4-Dihydroxyphenylpyruvate
3,4-Dihydroxyphenylpyruvic acid
3,4-Dihydroxyphenylpyruvic acid, alpha-(14)C-labeled
3-(3,4-Dihydroxyphenyl)-2-oxopropanoate
DHPPA
dhppa
metacyc.compound:34-DIHYDROXYPHENYLPYRUVATE
metacycM:34-DIHYDROXYPHENYLPYRUVATE
3-(3,4-dihydroxyphenyl)pyruvate
3,4-dihydroxyphenylpyruvate
3-(3,4-dihydroxyphenyl)-2-oxo-propanoic acid
envipath:...7b490b41e538
envipathM:...7b490b41e538
compound 44327
envipath:...b4f35164354f
envipathM:...b4f35164354f
compound 766
chebi:11698
chebi:19890
keggC:M_C04045
seedM:M_cpd02502
secondary/obsolete/fantasy identifier