Feedback

3-(3,4-dihydroxyphenyl)pyruvate

Properties
MNX_IDMNXM1887
formulaC9H7O5
charge-1
mass195.14888
referencechebi:29055
Image of MNXM1887
InChIKeyLQQFFJFGLSKYIR-UHFFFAOYSA-M
InChIInChI=1S/C9H8O5/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,10-11H,4H2,(H,13,14)/p-1
SMILESOc1ccc(CC(=O)C([O-])=O)cc1O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref9
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
sabiorkM:30967 3,4-Dihydroxyphenylpyruvate
envipath:...7b490b41e538 compound 44327
chebi:29055 3-(3,4-dihydroxyphenyl)pyruvate
3,4-dihydroxyphenylpyruvate
3-(3,4-dihydroxyphenyl)-2-oxopropanoate
seedM:cpd02502 3-(3,4-Dihydroxyphenyl)pyruvate
3,4-Dihydroxyphenylpyruvate
3,4-dihydroxyphenylpyruvate
3-(3,4-dihydroxyphenyl)-2-oxo-propanoic acid
3-(3,4-dihydroxyphenyl)pyruvate
chebi:11698
chebi:19890
keggC:M_C04045
seedM:M_cpd02502
secondary/obsolete/fantasy identifier
hmdb:HMDB0125373 3-(3,4-dihydroxyphenyl)-2-oxopropanoic acid
3,4-Dihydroxy-a-oxobenzenepropanoate
3,4-Dihydroxy-a-oxobenzenepropanoic acid
3,4-Dihydroxy-alpha-oxobenzenepropanoate
3,4-Dihydroxy-alpha-oxobenzenepropanoic acid
3,4-Dihydroxyphenylpyruvate
3,4-Dihydroxyphenylpyruvic acid, alpha-(14)C-labeled
DHPPA
dhppa
sabiorkM:7039 3-(3,4-Dihydroxyphenyl)pyruvate
metacycM:34-DIHYDROXYPHENYLPYRUVATE 3-(3,4-dihydroxyphenyl)pyruvate
3,4-dihydroxyphenylpyruvate
3-(3,4-dihydroxyphenyl)-2-oxo-propanoic acid
chebi:19891 3,4-dihydroxyphenylpyruvic acid
3,4-Dihydroxyphenylpyruvate
3,4-dihydroxy-alpha-oxobenzenepropanoic acid
3-(3,4-dihydroxyphenyl)-2-oxopropanoic acid
DHPPA
envipath:...b4f35164354f compound 766
keggC:C04045 3-(3,4-Dihydroxyphenyl)pyruvate
3,4-Dihydroxyphenylpyruvate
MNXM724375is deprecated and replaced by this entry
MNXM724448is deprecated and replaced by this entry