Feedback

3-oxo-3-ureidopropanoate

Properties
MNX_IDMNXM1891
formulaC4H5N2O4
charge-1
mass145.09358
referencechebi:58775
Image of MNXM1891
InChIKeyUCUUMUFWVSUBOL-UHFFFAOYSA-M
InChIInChI=1S/C4H6N2O4/c5-4(10)6-2(7)1-3(8)9/h1H2,(H,8,9)(H3,5,6,7,10)/p-1
SMILESNC(=O)NC(=O)CC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref5
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:49049 3-oxo-3-ureidopropanoic acid
3-(carbamoylamino)-3-oxopropanoic acid
3-Oxo-3-ureidopropanoate
Malonuric acid
seedM:cpd11256 Malonuric acid
3-(carbamoylamino)-3-oxopropanoate
3-Oxo-3-ureidopropanoate
3-oxo-3-ureidopropanoate
3-oxo-3-ureidopropionic acid
N-malonylurea
ureidomalonate
ureidomalonic acid
chebi:58775 3-oxo-3-ureidopropanoate
3-(carbamoylamino)-3-oxopropanoate
metacycM:CPD-7299 ureidomalonate
1-carboxymalonamide
3-(carbamoylamino)-3-oxopropanoate
3-oxo-3-ureidopropanoate
3-oxo-3-ureidopropionic acid
N-malonylurea
ureidomalonic acid
chebi:49047
chebi:49048
keggC:M_C15607
seedM:M_cpd11256
secondary/obsolete/fantasy identifier
keggC:C15607 3-Oxo-3-ureidopropanoate
Malonuric acid