Feedback

4,5-dihydroxyphthalate

PropertiesImageOccurences in reactions
MNX_IDMNXM1894Image of MNXM1894
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC8H4O6
charge-2
mass196.00189
referencechebi:58051
InChIKeyYZBCICVNBHNLTK-UHFFFAOYSA-L
InChIInChI=1S/C8H6O6/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2,9-10H,(H,11,12)(H,13,14)/p-2
SMILESO=C([O-])c1cc(O)c(O)cc1C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58051
chebi:58051
4,5-dihydroxyphthalate
4,5-dihydroxybenzene-1,2-dicarboxylate
4,5-dihydroxyphthalate dianion
4,5-dihydroxyphthalate(2-)
envipath:...520bfb741ac3
envipathM:...520bfb741ac3
4,5-Dihydroxyphthalate
kegg.compound:C03233
keggC:C03233
4,5-Dihydroxyphthalate
4,5-Dihydroxyphthalic acid
seed.compound:cpd02070
seedM:cpd02070
4,5-Dihydroxyphthalate
4,5-Dihydroxyphthalic acid
4,5-dihydroxyphthalate
metacyc.compound:CPD-636
metacycM:CPD-636
4,5-dihydroxyphthalate
CHEBI:17199
chebi:17199
4,5-dihydroxyphthalic acid
4,5-Dihydroxyphthalate
4,5-Dihydroxyphthalic acid
chebi:11924
chebi:1746
chebi:20273
keggC:M_C03233
seedM:M_cpd02070
secondary/obsolete/fantasy identifier