Feedback

4-pyridoxolactone

PropertiesImageOccurences in reactions
MNX_IDMNXM1896Image of MNXM1896
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC8H7NO3
charge0
mass165.14612
referencechebi:16871
InChIKeyHHPDVQLBYQFYFA-UHFFFAOYSA-N
InChIInChI=1S/C8H7NO3/c1-4-7(10)6-5(2-9-4)3-12-8(6)11/h2,10H,3H2,1H3
SMILESCc1ncc2COC(=O)c2c1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16871
chebi:16871
4-pyridoxolactone
4-Pyridoxic acid lactone
4-Pyridoxolactone
4-pyridoxic acid lactone
7-hydroxy-6-methylfuro[3,4-c]pyridin-1(3H)-one
sabiork.compound:5343
sabiorkM:5343
envipath:...8604717c958f
envipathM:...8604717c958f
4-Pyridoxolactone
hmdb:HMDB0003454 4-Pyridoxolactone
4-Pyridoxate lactone
4-Pyridoxic acid lactone
4-pyridoxolactone
7-hydroxy-6-methyl-1H,3H-furo[3,4-c]pyridin-1-one
beta-Pyracin
kegg.compound:C00971
keggC:C00971
4-Pyridoxolactone
4-Pyridoxic acid lactone
seed.compound:cpd00715
seedM:cpd00715
4-Pyridoxolactone
4-Pyridoxic acid lactone
4-pyridoxolactone
metacyc.compound:CPD-375
metacycM:CPD-375
4-pyridoxolactone
hmdb:HMDB03454
chebi:12044
chebi:1929
chebi:20475
keggC:M_C00971
seedM:M_cpd00715
secondary/obsolete/fantasy identifier