Feedback

4-aminobutanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM192Image of MNXM192
#reac
in my sandbox 0
in MNXref (generic)36
in models (compartimentalized) 52
formulaC4H9NO2
charge0
mass103.06333
referencechebi:59888
InChIKeyBTCSSZJGUNDROE-UHFFFAOYSA-N
InChIInChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)
SMILES[NH3+]CCCC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-352003
reactomeM:R-ALL-352003
reactome:R-ALL-352011
reactomeM:R-ALL-352011
reactome:R-ALL-428571
reactomeM:R-ALL-428571
reactome:R-ALL-916850
reactomeM:R-ALL-916850
reactome:R-ALL-936479
reactomeM:R-ALL-936479
CHEBI:59888
chebi:59888
4-aminobutanoate
4-ammoniobutanoate
4-azaniumylbutanoate
gamma-aminobutyric acid zwitterion
bigg.metabolite:4abut
biggM:4abut
4-Aminobutanoate
sabiork.compound:2021
sabiorkM:2021
4-Aminobutanoate
4-Aminobutanoic acid
4-Aminobutylate
4-Aminobutyrate
4-Aminobutyric acid
GABA
gamma-Aminobutyrate
gamma-Aminobutyric acid
kegg.compound:C00334
keggC:C00334
4-Aminobutanoate
4-Aminobutanoic acid
4-Aminobutyrate
4-Aminobutyric acid
GABA
gamma-Aminobutyric acid
lipidmaps:LMFA01100039
lipidmapsM:LMFA01100039
4-amino-butanoic acid
4-Aminobutanoic acid
4-amino-butanoic acid
envipath:...b83421426cbb
envipathM:...b83421426cbb
4-aminobutanoate
metacyc.compound:4-AMINO-BUTYRATE
metacycM:4-AMINO-BUTYRATE
4-aminobutanoate
4-NH2-but
4-NH3-but
4-amino-n-butyric acid
4-aminobutyrate
4-aminobutyric acid
GABA
g-amino-n-butyric acid
gamma-amino-N-butyrate
gamma-amino-n-butyric acid
gamma-aminobutyrate
seed.compound:cpd00281
seedM:cpd00281
GABA
4-Aminobutanoate
4-Aminobutanoic acid
4-Aminobutylate
4-Aminobutyrate
4-Aminobutyric acid
4-NH2-but
4-NH3-but
4-amino-n-butyric acid
4-aminobutanoate
4-aminobutyrate
4-aminobutyric acid
4abut
g-amino-n-butyric acid
gamma-Aminobutyric acid
gamma-amino-N-butyrate
gamma-amino-n-butyric acid
gamma-aminobutyrate
kegg.drug:D00058
keggD:D00058
gamma-Aminobutyric acid (JAN)
Gammalon (TN)
hmdb:HMDB0000112 gamma-Aminobutyric acid
3-Carboxypropylamine
4 Aminobutanoic acid
4 Aminobutyric acid
4-Amino-butanoate
4-Aminobutanoate
4-Aminobutanoic acid
4-Aminobutyrate
4-Aminobutyric acid
4-aminobutanoic acid
4Abu
Acid, hydrochloride gamma-aminobutyric
Aminalon
Aminalone
GABA
GABA, lithium
GAMMA-AMINO-butanoIC ACID
Gaballon
Gamarex
Gammalon
Gammalone
Gammar
Gammasol
Hydrochloride gamma-aminobutyric acid
Lithium gaba
Mielogen
Mielomade
Omega-aminobutyrate
Omega-aminobutyric acid
Piperidate
Piperidic acid
Piperidinate
Piperidinic acid
W-Aminobutyrate
W-Aminobutyric acid
g-AMINO-butanoate
g-AMINO-butanoic acid
g-Amino-N-butyrate
g-Amino-N-butyric acid
g-Aminobutanoate
g-Aminobutanoic acid
g-Aminobuttersaeure
g-Aminobutyrate
g-Aminobutyric acid
gamma Aminobutyrate
gamma Aminobutyric acid
gamma Aminobutyric acid, hydrochloride
gamma Aminobutyric acid, monolithium salt
gamma Aminobutyric acid, monosodium salt
gamma(amino)-butyric acid
gamma-AMINO-butanoate
gamma-Amino-N-butyrate
gamma-Amino-N-butyric acid
gamma-Aminobutanoate
gamma-Aminobutanoic acid
gamma-Aminobuttersaeure
gamma-Aminobutyrate
gamma-Aminobutyric acid, calcium salt (2:1)
gamma-Aminobutyric acid, hydrochloride
gamma-Aminobutyric acid, monolithium salt
gamma-Aminobutyric acid, monosodium salt
gamma-Aminobutyric acid, zinc salt (2:1)
gamma-amino-N-butyrate
gamma-amino-N-butyric acid
gamma-amino-butanoate
gamma-amino-butanoic acid
gamma-aminobutanoate
gamma-aminobutanoic acid
gamma-aminobuttersaeure
gamma-aminobutyrate
gamma-aminobutyric acid
CHEBI:30566
chebi:30566
gamma-aminobutyrate
4-Amino-butyrat
4-Aminobutylate
4-aminobutanoate
4-aminobutanoic acid ion (1-)
4-aminobutyrate
gamma-aminobutanoate
gamma-aminobutyrate anion
CHEBI:16865
chebi:16865
gamma-aminobutyric acid
4-Aminobutanoic acid
4-Aminobutyric acid
4-aminobutanoic acid
4-aminobutyric acid
4Abu
GABA
GAMMA-AMINO-BUTANOIC ACID
gamma-Aminobuttersaeure
gamma-Aminobutyric acid
gamma-amino-n-butyric acid
gamma-aminobutanoic acid
omega-aminobutyric acid
piperidic acid
piperidinic acid
hmdb:HMDB00112
chebi:11961
chebi:1786
chebi:193777
chebi:20317
chebi:20318
chebi:40483
biggM:M_4abut
keggC:M_C00334
keggD:M_D00058
seedM:M_cpd00281
secondary/obsolete/fantasy identifier