Feedback

N-acetylanthranilate

PropertiesImageOccurences in reactions
MNX_IDMNXM1939Image of MNXM1939
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 1
formulaC9H8NO3
charge-1
mass178.16476
referencechebi:16803
InChIKeyQSACCXVHEVWNMX-UHFFFAOYSA-M
InChIInChI=1S/C9H9NO3/c1-6(11)10-8-5-3-2-4-7(8)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13)/p-1
SMILESCC(=O)Nc1ccccc1C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16803
chebi:16803
N-acetylanthranilate
2-(acetylamino)benzoate
2-acetamidobenzoate
N-Acetylanthranilate
bigg.metabolite:acanth
biggM:acanth
envipath:...0c9154d9272c
envipathM:...0c9154d9272c
N-Acetylanthranilate
sabiork.compound:8550
sabiorkM:8550
N-Acetylanthranilate
2-(Acetylamino)-benzoic acid
seed.compound:cpd03773
seedM:cpd03773
N-Acetylanthranilate
2-(Acetylamino)-benzoic acid
2-(acetylamino)-benzoate
N-Acetylanthranilic acid
N-acetylanthranilate
N-acetylanthranilic acid
acanth
kegg.compound:C06332
keggC:C06332
N-Acetylanthranilate
2-(Acetylamino)-benzoic acid
N-Acetylanthranilic acid
metacyc.compound:N-ACETYLANTHRANILATE
metacycM:N-ACETYLANTHRANILATE
N-acetylanthranilate
2-(acetylamino)-benzoate
CHEBI:36555
chebi:36555
N-acetylanthranilic acid
2-(Acetylamino)-benzoic acid
2-(Acetylamino)benzoic acid
2-Carboxyacetanilide
2-acetamidobenzoic acid
N-Acetylanthranilic acid
o-Acetamidobenzoic acid
o-Acetoaminobenzoic acid
chebi:12465
chebi:19414
chebi:21602
chebi:32578
chebi:7194
biggM:M_acanth
keggC:M_C06332
seedM:M_cpd03773
secondary/obsolete/fantasy identifier