Feedback

N-acetylanthranilate

Properties
MNX_IDMNXM1939
formulaC9H8NO3
charge-1
mass178.16476
referencechebi:16803
Image of MNXM1939
InChIKeyQSACCXVHEVWNMX-UHFFFAOYSA-M
InChIInChI=1S/C9H9NO3/c1-6(11)10-8-5-3-2-4-7(8)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13)/p-1
SMILESCC(=O)Nc1ccccc1C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models1

Similar chemical compounds in external resources
IdentifierDescription
metacycM:N-ACETYLANTHRANILATE N-acetylanthranilate
2-(acetylamino)-benzoate
sabiorkM:8550 N-Acetylanthranilate
2-(Acetylamino)-benzoic acid
chebi:16803 N-acetylanthranilate
2-(acetylamino)benzoate
2-acetamidobenzoate
N-Acetylanthranilate
biggM:M_acanth
chebi:12465
chebi:19414
chebi:21602
chebi:32578
chebi:7194
keggC:M_C06332
seedM:M_cpd03773
secondary/obsolete/fantasy identifier
keggC:C06332 N-Acetylanthranilate
2-(Acetylamino)-benzoic acid
N-Acetylanthranilic acid
chebi:36555 N-acetylanthranilic acid
2-(Acetylamino)-benzoic acid
2-(Acetylamino)benzoic acid
2-Carboxyacetanilide
2-acetamidobenzoic acid
N-Acetylanthranilic acid
o-Acetamidobenzoic acid
o-Acetoaminobenzoic acid
biggM:acanth
envipath:...0c9154d9272c
N-Acetylanthranilate
seedM:cpd03773 N-Acetylanthranilate
2-(Acetylamino)-benzoic acid
2-(acetylamino)-benzoate
N-Acetylanthranilic acid
N-acetylanthranilate
N-acetylanthranilic acid
acanth