Feedback

sulfoacetate

PropertiesImageOccurences in reactions
MNX_IDMNXM1949Image of MNXM1949
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 8
formulaC2H2O5S
charge-2
mass137.96339
referencechebi:58824
InChIKeyAGGIJOLULBJGTQ-UHFFFAOYSA-L
InChIInChI=1S/C2H4O5S/c3-2(4)1-8(5,6)7/h1H2,(H,3,4)(H,5,6,7)/p-2
SMILESO=C([O-])CS(=O)(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58824
chebi:58824
sulfoacetate
2-sulfonatoacetate
sulfonatoacetate
bigg.metabolite:sula
biggM:sula
bigg.metabolite:sulfac
biggM:sulfac
Sulfoacetate
kegg.compound:C14179
keggC:C14179
Sulfoacetate
Sulfoacetic acid
seed.compound:cpd09878
seedM:cpd09878
Sulfoacetate
Sulfoacetic acid
sula
sulfoacetate
metacyc.compound:CPD-10246
metacycM:CPD-10246
sulfoacetate
CHEBI:50519
chebi:50519
sulfoacetic acid
2-sulfoacetic acid
Sulfoacetate
Sulfoacetic acid
sulfoethanoic acid
sulphoacetic acid
chebi:34987
chebi:49876
biggM:M_sula
biggM:M_sulfac
keggC:M_C14179
seedM:M_cpd09878
secondary/obsolete/fantasy identifier