Feedback

sulfoacetate

Properties
MNX_IDMNXM1949
formulaC2H2O5S
charge-2
mass138.10028
referencechebi:58824
Image of MNXM1949
InChIKeyAGGIJOLULBJGTQ-UHFFFAOYSA-L
InChIInChI=1S/C2H4O5S/c3-2(4)1-8(5,6)7/h1H2,(H,3,4)(H,5,6,7)/p-2
SMILES[O-]C(=O)CS([O-])(=O)=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref7
Distinct compatimentalized reactions in models8

Similar chemical compounds in external resources
IdentifierDescription
chebi:58824 sulfoacetate
2-sulfonatoacetate
sulfonatoacetate
chebi:50519 sulfoacetic acid
2-sulfoacetic acid
Sulfoacetate
Sulfoacetic acid
sulfoethanoic acid
sulphoacetic acid
biggM:sula
biggM:sulfac
Sulfoacetate
seedM:cpd09878 Sulfoacetate
Sulfoacetic acid
sula
sulfoacetate
biggM:M_sula
biggM:M_sulfac
chebi:34987
chebi:49876
keggC:M_C14179
seedM:M_cpd09878
secondary/obsolete/fantasy identifier
keggC:C14179 Sulfoacetate
Sulfoacetic acid
metacycM:CPD-10246 sulfoacetate