Feedback

taurolithocholate sulfate

PropertiesImageOccurences in reactions
MNX_IDMNXM1950Image of MNXM1950
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 9
formulaC26H43NO8S2
charge-2
mass561.75356
referencechebi:58301
InChIKeyHSNPMXROZIQAQD-GBURMNQMSA-L
InChIInChI=1S/C26H45NO8S2/c1-17(4-9-24(28)27-14-15-36(29,30)31)21-7-8-22-20-6-5-18-16-19(35-37(32,33)34)10-12-25(18,2)23(20)11-13-26(21,22)3/h17-23H,4-16H2,1-3H3,(H,27,28)(H,29,30,31)(H,32,33,34)/p-2/t17-,18-,19-,20+,21-,22+,23+,25+,26-/m1/s1
SMILESC[C@H](CCC(=O)NCCS([O-])(=O)=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@@H](CC[C@]4(C)[C@H]3CC[C@]12C)OS([O-])(=O)=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58301
chebi:58301
taurolithocholate sulfate
2-[(24-oxo-3alpha-sulfonatooxy-5beta-cholan-24-yl)amino]ethanesulfonate
taurolithocholic acid sulfate dianion
taurolithocholic acid sulfate(2-)
bigg.metabolite:HC02198
biggM:HC02198
2-[(4R)-4-[(1S,2S,5R,7R,10R,11S,14R,15R)-2,15-dimethyl-5-(sulfonatooxy)tetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]pentanamido]ethane-1-sulfonate
seed.compound:cpd02286
seedM:cpd02286
Taurolithocholate sulfate
3alpha-Sulfatolithocholyltaurine
3alpha-sulfatolithocholyltaurine
Taurolithocholic acid 3-sulfate
taurolithocholate sulfate
taurolithocholic acid 3-sulfate
kegg.compound:C03642
keggC:C03642
Taurolithocholate sulfate
3alpha-Sulfatolithocholyltaurine
Taurolithocholic acid 3-sulfate
lipidmaps:LMST05020003
lipidmapsM:LMST05020003
Taurolithocholate sulfate
N-(3alpha-hydroxy-5beta-cholan-24-oyl)-taurine 3-sulfate
hmdb:HMDB0002580 Taurolithocholic acid 3-sulfate
(3a-Sulfato-5b-cholan-24-oyl)-2'-aminoethanesulfonate
(3a-Sulfato-5b-cholan-24-oyl)-2'-aminoethanesulfonic acid
(3a-Sulphato-5b-cholan-24-oyl)-2'-aminoethanesulphonate
(3a-Sulphato-5b-cholan-24-oyl)-2'-aminoethanesulphonic acid
(3alpha-Sulfato-5beta-cholan-24-oyl)-2'-aminoethanesulfonate
(3alpha-Sulfato-5beta-cholan-24-oyl)-2'-aminoethanesulfonic acid
(3alpha-Sulphato-5beta-cholan-24-oyl)-2'-aminoethanesulphonate
(3alpha-Sulphato-5beta-cholan-24-oyl)-2'-aminoethanesulphonic acid
(3alpha-sulfato-5beta-cholan-24-oyl)-2'-aminoethanesulfonate
(3alpha-sulfato-5beta-cholan-24-oyl)-2'-aminoethanesulfonic acid
(3alpha-sulphato-5beta-cholan-24-oyl)-2'-aminoethanesulphonate
(3alpha-sulphato-5beta-cholan-24-oyl)-2'-aminoethanesulphonic acid
2-[(4R)-4-[(1S,2S,5R,7R,10R,11S,14R,15R)-2,15-dimethyl-5-(sulfooxy)tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl]pentanamido]ethane-1-sulfonic acid
3a-Sulfatolithocholyltaurine
3a-Sulphatolithocholyltaurine
3alpha-Sulfatolithocholyltaurine
3alpha-Sulphatolithocholyltaurine
3alpha-sulfatolithocholyltaurine
3alpha-sulphatolithocholyltaurine
SLCT-3-Sulfate
SLCT-3-Sulfuric acid
SLCT-3-Sulphate
SLCT-3-Sulphuric acid
TLC-S
Taurolithocholate 3-sulfate
Taurolithocholate 3-sulphate
Taurolithocholate sulfate
Taurolithocholate sulphate
Taurolithocholic acid 3-sulfuric acid
Taurolithocholic acid 3-sulphate
Taurolithocholic acid 3-sulphuric acid
Taurolithocholic acid sulfate
Taurolithocholic acid sulfuric acid
Taurolithocholic acid sulphate
Taurolithocholic acid sulphuric acid
tlc-S
metacyc.compound:TAUROLITHOCHOLATE-SULFATE
metacycM:TAUROLITHOCHOLATE-SULFATE
taurolithocholate sulfate
3alpha-sulfatolithocholyltaurine
taurolithocholic acid 3-sulfate
reactome:R-ALL-176483
reactomeM:R-ALL-176483
reactome:R-ALL-433120
reactomeM:R-ALL-433120
CHEBI:17864
chebi:17864
taurolithocholic acid sulfate
(3alpha-sulfato-5beta-cholan-24-oyl)-2'-aminoethanesulfonate
2-[(24-oxo-3alpha-sulfooxy-5beta-cholan-24-yl)amino]ethanesulfonic acid
3alpha-Sulfatolithocholyltaurine
Slct-3-sulfate
TLC-S
Taurolithocholate 3-sulfate
Taurolithocholate sulfate
Taurolithocholic acid 3-sulfate
hmdb:HMDB02580
chebi:15200
chebi:1716
chebi:26858
chebi:9412
biggM:M_HC02198
keggC:M_C03642
seedM:M_cpd02286
secondary/obsolete/fantasy identifier