Feedback

(S)-2-hydroxymethylglutaric acid

PropertiesImageOccurences in reactions
MNX_IDMNXM1983Image of MNXM1983
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC6H8O5
charge-2
mass160.12472
referencechebi:49076
InChIKeyXPQIPNORJZZYPV-BYPYZUCNSA-L
InChIInChI=1S/C6H10O5/c7-3-4(6(10)11)1-2-5(8)9/h4,7H,1-3H2,(H,8,9)(H,10,11)/p-2/t4-/m0/s1
SMILESOC[C@H](CCC([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:49076
chebi:49076
(S)-2-hydroxymethylglutaric acid
(2S)-2-(hydroxymethyl)pentanedioic acid
(S)-2-(Hydroxymethyl)glutarate
kegg.compound:C16390
keggC:C16390
(S)-2-(Hydroxymethyl)glutarate
seed.compound:cpd15096
seedM:cpd15096
(S)-2-(Hydroxymethyl)glutarate
(S)-2-hydroxymethylglutarate
metacyc.compound:CPD-9438
metacycM:CPD-9438
(S)-2-hydroxymethylglutarate
CHEBI:58777
chebi:58777
2-(hydroxymethyl)glutarate
2-(hydroxymethyl)pentanedioate
2-hydroxymethylglutarate
CHEBI:49077
chebi:49077
2-hydroxymethylglutaric acid
2-(hydroxymethyl)pentanedioic acid
keggC:M_C16390
seedM:M_cpd15096
secondary/obsolete/fantasy identifier