Feedback

2-iminoacetate

PropertiesImageOccurences in reactions
MNX_IDMNXM1984Image of MNXM1984
#reac
in my sandbox 0
in MNXref (generic)15
in models (compartimentalized) 7
formulaC2H3NO2
charge0
mass73.01638
referencechebi:77846
InChIKeyTVMUHOAONWHJBV-UHFFFAOYSA-N
InChIInChI=1S/C2H3NO2/c3-1-2(4)5/h1,3H,(H,4,5)
SMILES[NH2+]=CC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:77846
chebi:77846
2-iminoacetate
dehydroglycine zwitterion
iminioacetate
metacyc.compound:CPD-12279
metacycM:CPD-12279
2-iminoacetate
dehydroglycine
iminoacetate
iminoacetic acid
bigg.metabolite:dhgly
biggM:dhgly
Dehydroglycine
seed.compound:cpd14545
seedM:cpd14545
Iminoglycine
2-Iminoacetate
2-iminoacetate
Iminoacetic acid
dehydroglycine
iminoacetate
iminoacetic acid
kegg.compound:C15809
keggC:C15809
Iminoglycine
2-Iminoacetate
Iminoacetic acid
CHEBI:53664
chebi:53664
dehydroglycinate
iminoacetate
CHEBI:53647
chebi:53647
dehydroglycine
Iminoacetic acid
Iminoglycine
iminoacetic acid
biggM:M_dhgly
keggC:M_C15809
seedM:M_cpd14545
secondary/obsolete/fantasy identifier