Feedback

 

2-iminoacetate

Image of MNXM1984
Properties
MNX_IDMNXM1984
formulaC2H3NO2
charge0
mass73.0507
referencechebi:77846
InChIKeyTVMUHOAONWHJBV-UHFFFAOYSA-N
InChIInChI=1S/C2H3NO2/c3-1-2(4)5/h1,3H,(H,4,5)
SMILES[O-]C(=O)C=[NH2+]

This chemical compound does not exist in my selection



Occurrences of 2-iminoacetate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:dhgly Dehydroglycine
chebi:53647 Iminoacetic acid
Iminoglycine
TVMUHOAONWHJBV-UHFFFAOYSA-N
dehydroglycine
iminoacetic acid
chebi:53664 TVMUHOAONWHJBV-UHFFFAOYSA-M
dehydroglycinate
iminoacetate
chebi:77846 2-iminoacetate
TVMUHOAONWHJBV-UHFFFAOYSA-N
dehydroglycine zwitterion
iminioacetate
kegg:C15809 2-Iminoacetate
Iminoacetic acid
Iminoglycine
metacyc:CPD-12279 2-iminoacetate
CPD-12279
dehydroglycine
iminoacetate
iminoacetic acid
seed:cpd14545 Iminoacetic acid
Iminoglycine