Feedback

 

3'-AMP

Image of MNXM1985
Properties
MNX_IDMNXM1985
formulaC10H12N5O7P
charge-2
mass345.2064
referencechebi:60880
InChIKeyLNQVTSROQXJCDD-KQYNXXCUSA-L
InChIInChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(17)7(4(1-16)21-10)22-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/p-2/t4-,6-,7-,10-/m1/s1
SMILESNc1ncnc2n(cnc12)[C@@H]1O[C@H](CO)[C@@H](OP([O-])([O-])=O)[C@H]1O

This chemical compound does not exist in my selection



Occurrences of 3'-AMP in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3amp 3'-AMP
chebi:1333
chebi:22241
chebi:28931
chebi:40872
3'-AMP
3'-Adenosine monophosphate
3'-Adenylic acid
3'-adenylic acid
AMP 3'-phosphate
Adenosine 3'-phosphate
Adenosine-3'-monophosphate
LNQVTSROQXJCDD-KQYNXXCUSA-N
adenosine 3'-monophosphate
synadenylic acid
chebi:60880 3'-AMP
3'-AMP(2-)
3'-O-phosphonatoadenosine
3'-adenylate
LNQVTSROQXJCDD-KQYNXXCUSA-L
adenine-3'-monophosphate (2-)
hmdb:HMDB03540
hmdb:HMDB06550
3'-AMP
adenosine-3'-phosphate
{[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy}phosphonic acid
metacyc:CPD-3706 3'-AMP
3'-adenosine monophosphate
3'-adenylic acid
CPD-3706
adenosine 3'-monophosphate
adenosine 3'-phosphate
adenosine-3'-monophosphate
adenosine-3'-monophosphoric acid
kegg:C01367
sabiork:1715
3'-AMP
3'-Adenosine monophosphate
3'-Adenylic acid
AMP 3'-phosphate
Adenosine 3'-phosphate
Adenosine-3'-monophosphate
seed:cpd00988 3'-AMP
3'-Adenosine monophosphate
3'-Adenylic acid
3amp
AMP 3'-phosphate
Adenosine 3'-phosphate
Adenosine-3'-monophosphate
deprecated:MNXM91079