Feedback

3'-AMP

Properties
MNX_IDMNXM1985
formulaC10H12N5O7P
charge-2
mass345.205541
referencechebi:60880
Image of MNXM1985
InChIKeyLNQVTSROQXJCDD-KQYNXXCUSA-L
InChIInChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(17)7(4(1-16)21-10)22-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/p-2/t4-,6-,7-,10-/m1/s1
SMILESNc1ncnc2n(cnc12)[C@@H]1O[C@H](CO)[C@@H](OP([O-])([O-])=O)[C@H]1O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref9
Distinct compatimentalized reactions in models4

Similar chemical compounds in external resources
IdentifierDescription
biggM:M_3amp
chebi:1333
chebi:22241
chebi:40872
hmdb:HMDB0006550
hmdb:HMDB03540
hmdb:HMDB06550
keggC:M_C01367
seedM:M_cpd00988
secondary/obsolete/fantasy identifier
sabiorkM:1715 Adenosine 3'-phosphate
3'-AMP
3'-Adenosine monophosphate
3'-Adenylic acid
AMP 3'-phosphate
Adenosine-3'-monophosphate
seedM:cpd00988 3'-AMP
3'-Adenosine monophosphate
3'-Adenylic acid
3'-adenosine monophosphate
3'-adenylic acid
3amp
AMP 3'-phosphate
Adenosine 3'-phosphate
Adenosine-3'-monophosphate
adenosine 3'-monophosphate
adenosine 3'-phosphate
adenosine-3'-monophosphate
adenosine-3'-monophosphoric acid
chebi:28931 3'-AMP
3'-Adenosine monophosphate
3'-Adenylic acid
3'-adenylic acid
AMP 3'-phosphate
Adenosine 3'-phosphate
Adenosine-3'-monophosphate
adenosine 3'-monophosphate
synadenylic acid
chebi:60880 3'-AMP
3'-AMP(2-)
3'-O-phosphonatoadenosine
3'-adenylate
adenine-3'-monophosphate (2-)
keggC:C01367 3'-AMP
3'-Adenosine monophosphate
3'-Adenylic acid
AMP 3'-phosphate
Adenosine 3'-phosphate
Adenosine-3'-monophosphate
biggM:3amp 3 AMP
hmdb:HMDB0003540 3'-AMP
2' Adenosine monophosphate
2' Adenylic acid
2'-AMP
2'-Adenosine monophosphate
2'-Adenylic acid
3'-Adenosine monophosphate
3'-Adenosine monophosphoric acid
3'-Adenylate
3'-Adenylic acid
5' Adenylic acid
5'-Adenylic acid
5'-Phosphate, adenosine
AMP
AMP 3'-Phosphate
AMP 3'-Phosphoric acid
Acid, 2'-adenylic
Acid, 5'-adenylic
Adenosine 2' phosphate
Adenosine 2'-phosphate
Adenosine 3' phosphate
Adenosine 3'-monophosphate
Adenosine 3'-monophosphoric acid
Adenosine 3'-phosphate
Adenosine 3'-phosphoric acid
Adenosine 5' phosphate
Adenosine 5'-phosphate
Adenosine monophosphate
Adenosine phosphate dipotassium
Adenosine phosphate disodium
Adenosine-3'-monophosphate
Adenosine-3'-monophosphoric acid
Adenosine-3'-phosphate
Adenylic acid
Dipotassium, adenosine phosphate
Disodium, adenosine phosphate
Monophosphate, 2'-adenosine
Phosphaden
Phosphate dipotassium, adenosine
Phosphate disodium, adenosine
Synadenylate
Synadenylic acid
Yeast adenylic acid
adenosine-3'-phosphate
{[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy}phosphonic acid
metacycM:CPD-3706 adenosine 3'-monophosphate
3'-AMP
3'-adenosine monophosphate
3'-adenylic acid
adenosine 3'-phosphate
adenosine-3'-monophosphate
adenosine-3'-monophosphoric acid
MNXM91079is deprecated and replaced by this entry