Feedback

L-valine

PropertiesImageOccurences in reactions
MNX_IDMNXM199Image of MNXM199
#reac
in my sandbox 0
in MNXref (generic)223
in models (compartimentalized) 205
formulaC5H11NO2
charge0
mass117.14638
referencechebi:57762
InChIKeyKZSNJWFQEVHDMF-BYPYZUCNSA-N
InChIInChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1
SMILESCC(C)[C@H]([NH3+])C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-113540
reactomeM:R-ALL-113540
reactome:R-ALL-29702
reactomeM:R-ALL-29702
reactome:R-ALL-351992
reactomeM:R-ALL-351992
CHEBI:57762
chebi:57762
L-valine
(2S)-2-ammonio-3-methylbutanoate
(2S)-2-azaniumyl-3-methylbutanoate
L-valine zwitterion
CHEBI:87977
chebi:87977
((13)C5,(15)N)-valine
L-((13)C5,(15)N)valine
lipidmaps:LMFA01100046
lipidmapsM:LMFA01100046
2-Amino-3-methylbutanoic acid
2-Amino-3-methylbutanoic acid
bigg.metabolite:val__L
biggM:val__L
envipath:...ac1a3c2159c5
envipathM:...ac1a3c2159c5
L-Valine
hmdb:HMDB0000883 L-Valine
(2S)-2-amino-3-Methylbutanoate
(2S)-2-amino-3-Methylbutanoic acid
(2S)-2-amino-3-methylbutanoic acid
(S)-2-amino-3-Methyl-butanoate
(S)-2-amino-3-Methyl-butanoic acid
(S)-2-amino-3-Methylbutanoate
(S)-2-amino-3-Methylbutanoic acid
(S)-2-amino-3-Methylbutyrate
(S)-2-amino-3-Methylbutyric acid
(S)-Valine
(S)-a-amino-b-Methylbutyrate
(S)-a-amino-b-Methylbutyric acid
(S)-alpha-amino-beta-Methylbutyrate
(S)-alpha-amino-beta-Methylbutyric acid
2-amino-3-Methylbutanoate
2-amino-3-Methylbutanoic acid
2-amino-3-Methylbutyrate
2-amino-3-Methylbutyric acid
L Valine
L-(+)-a-Aminoisovalerate
L-(+)-a-Aminoisovaleric acid
L-(+)-alpha-Aminoisovalerate
L-(+)-alpha-Aminoisovaleric acid
L-(+)-alpha-aminoisovalerate
L-(+)-alpha-aminoisovaleric acid
L-Valin
L-a-amino-b-Methylbutyrate
L-a-amino-b-Methylbutyric acid
L-alpha-amino-beta-Methylbutyrate
L-alpha-amino-beta-Methylbutyric acid
L-alpha-amino-beta-methylbutyrate
L-alpha-amino-beta-methylbutyric acid
L-valine
V
VALINE
Val
kegg.compound:C00183
keggC:C00183
L-Valine
2-Amino-3-methylbutyric acid
seed.compound:cpd00156
seedM:cpd00156
L-Valine
2-Amino-3-methylbutyric acid
L-val
L-valine
val
val-L
valine
sabiork.compound:68
sabiorkM:68
L-Valine
2-Amino-3-methylbutyric acid
Val
CHEBI:32851
chebi:32851
L-valinate
(2S)-2-amino-3-methylbutanoate
L-valine anion
CHEBI:16414
chebi:16414
L-valine
(2S)-2-amino-3-methylbutanoic acid
(S)-valine
2-Amino-3-methylbutyric acid
L-(+)-alpha-Aminoisovaleric acid
L-Valin
L-Valine
L-alpha-Amino-beta-methylbutyric acid
V
VALINE
Val
metacyc.compound:VAL
metacycM:VAL
L-valine
L-val
V
val
valine
CHEBI:32852
chebi:32852
L-valinium
(1S)-1-carboxy-2-methylpropan-1-aminium
L-valine cation
sabiork.compound:23113
sabiorkM:23113
kegg.compound:C16436
keggC:C16436
Valine
kegg.drug:D00039
keggD:D00039
Valine (USP)
L-Valine (JP17)
seed.compound:cpd15141
seedM:cpd15141
Valine
cll_96
envipath:...007eb0537f0e
envipathM:...007eb0537f0e
compound 38807
CHEBI:32859
chebi:32859
valinate
2-amino-3-methylbutanoate
val(-)
valine anion
CHEBI:27266
chebi:27266
valine
2-amino-3-methylbutanoic acid
DL-valine
Hval
Valin
valina
CHEBI:32860
chebi:32860
valinium
1-carboxy-2-methylpropan-1-aminium
H2val(+)
valine cation
biggM:val-L
hmdb:HMDB0034366
hmdb:HMDB00883
hmdb:HMDB34366
chebi:13186
chebi:21417
chebi:46282
chebi:46376
chebi:46418
chebi:46484
chebi:6321
biggM:M_val__L
keggC:M_C00183
keggC:M_C16436
keggD:M_D00039
seedM:M_cpd00156
seedM:M_cpd15141
secondary/obsolete/fantasy identifier