Feedback

4-hydroxy-1-pyrroline-2-carboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM1992Image of MNXM1992
#reac
in my sandbox 0
in MNXref (generic)8
in models (compartimentalized) 2
formulaC5H6NO3
charge-1
mass128.10608
referencechebi:57745
InChIKeyAOMLMYXPXUTBQH-UHFFFAOYSA-M
InChIInChI=1S/C5H7NO3/c7-3-1-4(5(8)9)6-2-3/h3,7H,1-2H2,(H,8,9)/p-1
SMILESOC1CN=C(C1)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57745
chebi:57745
4-hydroxy-1-pyrroline-2-carboxylate
3-hydroxy-3,4-dihydro-2H-pyrrole-5-carboxylate
kegg.compound:C04282
keggC:C04282
1-Pyrroline-4-hydroxy-2-carboxylate
seed.compound:cpd02626
seedM:cpd02626
1-Pyrroline-4-hydroxy-2-carboxylate
1-pyrroline-4-hydroxy-2-carboxylate
hmdb:HMDB0002234 1-Pyrroline-4-hydroxy-2-carboxylate
3-hydroxy-3,4-dihydro-2H-pyrrole-5-carboxylic acid
4-Hydroxy-1-pyrroline-2-carboxylate
4-Hydroxy-1-pyrroline-2-carboxylic acid
4-hydroxy-4,5-dihydro-3H-pyrrole-2-carboxylic acid
metacyc.compound:CPD-1128
metacycM:CPD-1128
1-pyrroline-4-hydroxy-2-carboxylate
CHEBI:16352
chebi:16352
4-hydroxy-1-pyrroline-2-carboxylic acid
1-Pyrroline-4-hydroxy-2-carboxylate
3-hydroxy-3,4-dihydro-2H-pyrrole-5-carboxylic acid
hmdb:HMDB02234
chebi:11296
chebi:19094
chebi:684
keggC:M_C04282
seedM:M_cpd02626
secondary/obsolete/fantasy identifier