Feedback

6-hydroxyhexanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1994Image of MNXM1994
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 0
formulaC6H11O3
charge-1
mass131.14974
referencechebi:32383
InChIKeyIWHLYPDWHHPVAA-UHFFFAOYSA-M
InChIInChI=1S/C6H12O3/c7-5-3-1-2-4-6(8)9/h7H,1-5H2,(H,8,9)/p-1
SMILESOCCCCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:32383
chebi:32383
6-hydroxyhexanoate
5-hydroxypentanecarboxylate
envipath:...86fcb24893f5
envipathM:...86fcb24893f5
6-Hydroxyhexanoate
seed.compound:cpd03641
seedM:cpd03641
6-Hydroxyhexanoate
6-Hydroxyhexanoic acid
6-hydroxyhexanoate
hmdb:HMDB0012843 6-Hydroxyhexanoic acid
5-Carboxypentanol
5-Hydroxypentanecarboxylate
5-Hydroxypentanecarboxylic acid
6-Hydroxy caproate
6-Hydroxy caproic acid
6-Hydroxycaproate
6-Hydroxycaproic acid
6-Hydroxyhexanoate
6-hydroxyhexanoic acid
epsilon-Hydroxycaproate
epsilon-Hydroxycaproic acid
epsilon-Hydroxyhexanoate
epsilon-Hydroxyhexanoic acid
kegg.compound:C06103
keggC:C06103
6-Hydroxyhexanoic acid
6-Hydroxyhexanoate
lipidmaps:LMFA01050015
lipidmapsM:LMFA01050015
6-hydroxy caproic acid
6-hydroxy-hexanoic acid
FA(6:0(OH))
metacyc.compound:CPD-102
metacycM:CPD-102
6-hydroxyhexanoate
CHEBI:17869
chebi:17869
6-hydroxyhexanoic acid
5-carboxypentanol
5-hydroxypentanecarboxylic acid
6-Hydroxyhexanoate
6-Hydroxyhexanoic acid
6-hydroxy caproic acid
6-hydroxycaproic acid
epsilon-hydroxycaproic acid
epsilon-hydroxyhexanoic acid
hmdb:HMDB12843
chebi:12217
chebi:20727
chebi:2191
keggC:M_C06103
seedM:M_cpd03641
secondary/obsolete/fantasy identifier