Feedback

6-hydroxyhexanoate

Properties
MNX_IDMNXM1994
formulaC6H11O3
charge-1
mass131.14974
referencechebi:32383
Image of MNXM1994
InChIKeyIWHLYPDWHHPVAA-UHFFFAOYSA-M
InChIInChI=1S/C6H12O3/c7-5-3-1-2-4-6(8)9/h7H,1-5H2,(H,8,9)/p-1
SMILESOCCCCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
keggC:C06103 6-Hydroxyhexanoic acid
6-Hydroxyhexanoate
chebi:17869 6-hydroxyhexanoic acid
5-carboxypentanol
5-hydroxypentanecarboxylic acid
6-Hydroxyhexanoate
6-Hydroxyhexanoic acid
6-hydroxy caproic acid
6-hydroxycaproic acid
epsilon-hydroxycaproic acid
epsilon-hydroxyhexanoic acid
chebi:32383 6-hydroxyhexanoate
5-hydroxypentanecarboxylate
envipath:...86fcb24893f5 6-Hydroxyhexanoate
lipidmaps:LMFA01050015 6-hydroxy caproic acid
6-hydroxy-hexanoic acid
FA(6:0(OH))
chebi:12217
chebi:20727
chebi:2191
hmdb:HMDB12843
keggC:M_C06103
seedM:M_cpd03641
secondary/obsolete/fantasy identifier
seedM:cpd03641 6-Hydroxyhexanoate
6-Hydroxyhexanoic acid
6-hydroxyhexanoate
hmdb:HMDB0012843 6-Hydroxyhexanoic acid
5-Carboxypentanol
5-Hydroxypentanecarboxylate
5-Hydroxypentanecarboxylic acid
6-Hydroxy caproate
6-Hydroxy caproic acid
6-Hydroxycaproate
6-Hydroxycaproic acid
6-Hydroxyhexanoate
6-hydroxyhexanoic acid
epsilon-Hydroxycaproate
epsilon-Hydroxycaproic acid
epsilon-Hydroxyhexanoate
epsilon-Hydroxyhexanoic acid
metacycM:CPD-102 6-hydroxyhexanoate