Feedback

(2S)-4-acetamido-2-aminobutanoate

Properties
MNX_IDMNXM2023
formulaC6H12N2O3
charge0
mass160.17116
referencechebi:58929
Image of MNXM2023
InChIKeyYLZRFVZUZIJABA-YFKPBYRVSA-N
InChIInChI=1S/C6H12N2O3/c1-4(9)8-3-2-5(7)6(10)11/h5H,2-3,7H2,1H3,(H,8,9)(H,10,11)/t5-/m0/s1
SMILESCC(=O)NCC[C@H]([NH3+])C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB0031411 4-Acetamido-2-aminobutanoic acid
(2S)-2-amino-4-acetamidobutanoic acid
N(g)-Acetyldiaminobutyrate
N(g)-Acetyldiaminobutyric acid
N(gamma)-Acetyldiaminobutyric acid
N(gamma)-acetyldiaminobutyrate
N(gamma)-acetyldiaminobutyric acid
N-Acetyl-L-2,4-diaminobutanoate
N-Acetyl-L-2,4-diaminobutanoic acid
N-Acetyl-L-2,4-diaminobutyrate
N-Acetyl-L-2,4-diaminobutyric acid
N-g-Acetyldiaminobutyrate
N-g-Acetyldiaminobutyric acid
N-gamma-Acetyldiaminobutyrate
N-gamma-Acetyldiaminobutyric acid
N-gamma-acetyldiaminobutyrate
N-gamma-acetyldiaminobutyric acid
NADA
chebi:58929 (2S)-4-acetamido-2-aminobutanoate
(2S)-2-azaniumyl-4-acetamidobutanoate
(2S)-4-acetamido-2-ammoniobutanoate
(2S)-4-acetamido-2-azaniumylbutanoate
N(4)-acetyl-L-2,4-diaminobutyric acid zwitterion
metacycM:N-ACETYL-L-24-DIAMINOBUTANOATE (2S)-4-acetamido-2-aminobutanoate
N-acetyl-L-2,4-diaminobutanoate
N4-acetyl-L-2,4-diaminobutanoate
Ngamma-acetyl-L-2,4-diaminobutanoate
Ngamma-acetyl-L-2,4-diaminobutyrate
Ngamma-acetyl-L-2,4-diaminobutyric acid
keggC:C06442 N(gamma)-Acetyldiaminobutyrate
(2S)-4-Acetamido-2-aminobutanoate
N4-Acetyl-L-2,4-diaminobutanoate
N4-Acetyl-L-2,4-diaminobutyrate
chebi:7351 N(4)-acetyl-L-2,4-diaminobutyric acid
(2S)-4-(acetylamino)-2-aminobutanoic acid
N-Acetyl-L-2,4-diaminobutanoate
N-Acetyl-L-2,4-diaminobutyrate
N-gamma-Acetyldiaminobutyrate
seedM:cpd03862 N-gamma-Acetyldiaminobutyrate
(2S)-4-acetamido-2-aminobutanoate
N(gamma)-Acetyldiaminobutyrate
N-Acetyl-L-2,4-diaminobutanoate
N-Acetyl-L-2,4-diaminobutyrate
N-acetyl-L-2,4-diaminobutanoate
N4-Acetyl-L-2,4-diaminobutanoate
N4-Acetyl-L-2,4-diaminobutyrate
N4-acetyl-L-2,4-diaminobutanoate
NADA
Ngamma-acetyl-L-2,4-diaminobutanoate
Ngamma-acetyl-L-2,4-diaminobutyrate
Ngamma-acetyl-L-2,4-diaminobutyric acid
hmdb:HMDB31411
keggC:M_C06442
seedM:M_cpd03862
secondary/obsolete/fantasy identifier