Feedback

N-formylmaleamate

PropertiesImageOccurences in reactions
MNX_IDMNXM2024Image of MNXM2024
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 2
formulaC5H4NO4
charge-1
mass142.0896
referencechebi:59911
InChIKeyHSKSAKBZUITULZ-UPHRSURJSA-M
InChIInChI=1S/C5H5NO4/c7-3-6-4(8)1-2-5(9)10/h1-3H,(H,9,10)(H,6,7,8)/p-1/b2-1-
SMILES[O-]C(=O)\C=C/C(=O)NC=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:59911
chebi:59911
N-formylmaleamate
(2Z)-4-formamido-4-oxobut-2-enoate
(Z)-4-formamido-4-oxobut-2-enoate
N-formylmaleamate anion
bigg.metabolite:nfmalm
biggM:nfmalm
N-Formyl maleamic acid
seed.compound:cpd16741
seedM:cpd16741
N-Formyl maleamic acid
N-Formylmaleamic acid
N-formylmaleamate
N-formylmaleamic acid
nfmalm
sabiork.compound:31222
sabiorkM:31222
envipath:...ea640cee2698
envipathM:...ea640cee2698
N-Formylmaleamate
kegg.compound:C18232
keggC:C18232
N-Formylmaleamic acid
metacyc.compound:CPD-12278
metacycM:CPD-12278
N-formylmaleamate
N-formylmaleamic acid
CHEBI:59930
chebi:59930
lipidmaps:LMFA08020194
lipidmapsM:LMFA08020194
N-formylmaleamic acid
(2Z)-4-formamido-4-oxobut-2-enoic acid
(Z)-4-formamido-4-oxobut-2-enoic acid
biggM:M_nfmalm
keggC:M_C18232
seedM:M_cpd16741
secondary/obsolete/fantasy identifier