Feedback

N-formylmaleamate

Properties
MNX_IDMNXM2024
formulaC5H4NO4
charge-1
mass142.0896
referencechebi:59911
Image of MNXM2024
InChIKeyHSKSAKBZUITULZ-UPHRSURJSA-M
InChIInChI=1S/C5H5NO4/c7-3-6-4(8)1-2-5(9)10/h1-3H,(H,9,10)(H,6,7,8)/p-1/b2-1-
SMILES[O-]C(=O)\C=C/C(=O)NC=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models2

Similar chemical compounds in external resources
IdentifierDescription
keggC:C18232 N-Formylmaleamic acid
chebi:59911 N-formylmaleamate
(2Z)-4-formamido-4-oxobut-2-enoate
(Z)-4-formamido-4-oxobut-2-enoate
N-formylmaleamate anion
metacycM:CPD-12278 N-formylmaleamate
N-formylmaleamic acid
chebi:59930
lipidmaps:LMFA08020194
N-formylmaleamic acid
(2Z)-4-formamido-4-oxobut-2-enoic acid
(Z)-4-formamido-4-oxobut-2-enoic acid
seedM:cpd16741 N-Formyl maleamic acid
N-Formylmaleamic acid
N-formylmaleamate
N-formylmaleamic acid
nfmalm
envipath:...ea640cee2698
sabiorkM:31222
N-Formylmaleamate
biggM:nfmalm N-Formyl maleamic acid
biggM:M_nfmalm
keggC:M_C18232
seedM:M_cpd16741
secondary/obsolete/fantasy identifier