Feedback

3,4-dihydroxybenzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM204Image of MNXM204
#reac
in my sandbox 0
in MNXref (generic)49
in models (compartimentalized) 13
formulaC7H5O4
charge-1
mass153.01933
referencechebi:36241
InChIKeyYQUVCSBJEUQKSH-UHFFFAOYSA-M
InChIInChI=1S/C7H6O4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H,(H,10,11)/p-1
SMILESO=C([O-])c1ccc(O)c(O)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:36241
chebi:36241
3,4-dihydroxybenzoate
3,4-Dihydroxybenzoate
4,5-dihydroxybenzoate
bigg.metabolite:34dhbz
biggM:34dhbz
envipath:...efc74746beaf
envipathM:...efc74746beaf
3,4-Dihydroxybenzoate
sabiork.compound:1983
sabiorkM:1983
kegg.compound:C00230
keggC:C00230
3,4-Dihydroxybenzoate
3,4-Dihydroxybenzoic acid
Protocatechuate
Protocatechuic acid
reactome:R-ALL-175977
reactomeM:R-ALL-175977
CHEBI:36062
chebi:36062
3,4-dihydroxybenzoic acid
3,4-Dihydroxybenzoic acid
4,5-Dihydroxybenzoic acid
4-Carboxy-1,2-dihydroxybenzene
Protocatechuic acid
Protocatehuic acid
seed.compound:cpd00197
seedM:cpd00197
Protocatechuate
3,4-DHBA
3,4-Dihydroxybenzoate
3,4-Dihydroxybenzoic acid
3,4-dihydrobenzoic acid
3,4-dihydroxybenzoate
3,4-dihydroxybenzoic acid
34dhbz
4,5-dihydroxybenzoic acid
4-carboxy-1,2-dihydroxybenzene
Pca
Protocatechuic acid
benzoic acid, 3,4-dihydroxy-
catechol-4-carboxylic acid
protocatechuate
protocatechuic acid
protocatehuic acid
hmdb:HMDB0001856 Protocatechuic acid
2,4-Dihydroxybenzoate
2,4-Dihydroxybenzoic acid
3,4-DHBA
3,4-Dihydroxybenzoate
3,4-Dihydroxybenzoic acid
3,4-dihydroxybenzoic acid
4,5-Dihydroxybenzoate
4,5-Dihydroxybenzoic acid
4-Carboxy-1,2-dihydroxybenzene
Protocatechuate
Protocatechuic acid, carboxy-14C-labeled
Protocatechuic acid, monosodium salt
Protocatehuate
Protocatehuic acid
b-Resorcylate
b-Resorcylic acid
beta-Resorcylate
beta-Resorcylic acid
envipath:...74b58dbfbcfc
envipathM:...74b58dbfbcfc
compound 136
envipath:...f0aeebfeec63
envipathM:...f0aeebfeec63
compound 37917
metacyc.compound:3-4-DIHYDROXYBENZOATE
metacycM:3-4-DIHYDROXYBENZOATE
protocatechuate
3,4-DHBA
3,4-dihydrobenzoic acid
3,4-dihydroxybenzoate
3,4-dihydroxybenzoic acid
4,5-dihydroxybenzoic acid
4-carboxy-1,2-dihydroxybenzene
Pca
benzoic acid, 3,4-dihydroxy-
catechol-4-carboxylic acid
protocatechuic acid
protocatehuic acid
hmdb:HMDB01856
chebi:11694
chebi:1380
chebi:14955
chebi:16798
chebi:19878
chebi:19879
chebi:20270
chebi:20272
chebi:41912
biggM:M_34dhbz
keggC:M_C00230
seedM:M_cpd00197
secondary/obsolete/fantasy identifier