Feedback

(2S)-2-amino-4-deoxychorismate

PropertiesImageOccurences in reactions
MNX_IDMNXM2042Image of MNXM2042
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC10H10NO5
charge-1
mass224.19014
referencechebi:58792
InChIKeyOKLGKGPAZUNROU-YUMQZZPRSA-M
InChIInChI=1S/C10H11NO5/c1-5(9(12)13)16-7-4-2-3-6(8(7)11)10(14)15/h2-4,7-8H,1,11H2,(H,12,13)(H,14,15)/p-1/t7-,8-/m0/s1
SMILES[NH3+][C@@H]1[C@@H](OC(=C)C([O-])=O)C=CC=C1C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58792
chebi:58792
(2S)-2-amino-4-deoxychorismate
(5S,6S)-6-azaniumyl-5-[(1-carboxylatoethenyl)oxy]cyclohexa-1,3-diene-1-carboxylate
2-azaniumyl-2-deoxyisochorismate
metacyc.compound:CPD-9517
metacycM:CPD-9517
(2S)-2-amino-4-deoxy-chorismate
(2S)-2-amino-2-deoxy-isochorismate
(2S)-2-amino-2-deoxy-isochorismic acid
(2S)-2-amino-4-deoxy-chorismic acid
CHEBI:49197
chebi:49197
(2S)-2-amino-4-deoxychorismic acid
(2S)-2-Amino-4-deoxychorismate
(5S,6S)-6-amino-5-[(1-carboxyethenyl)oxy]cyclohexa-1,3-diene-1-carboxylic acid
(5S,6S)-6-amino-5-[(1-carboxyvinyl)oxy]cyclohexa-1,3-diene-1-carboxylic acid
2-amino-2-deoxyisochorismic acid
ADIC
seed.compound:cpd18037
seedM:cpd18037
2-Amino-2-deoxyisochorismate
kegg.compound:C18054
keggC:C18054
2-Amino-2-deoxyisochorismate
(2S)-2-Amino-4-deoxychorismate
seed.compound:cpd17073
seedM:cpd17073
2-amino-2-deoxyisochorismic acid
(2S)-2-Amino-4-deoxychorismate
(2S)-2-amino-2-deoxy-isochorismate
(2S)-2-amino-2-deoxy-isochorismic acid
(2S)-2-amino-4-deoxy-chorismate
(2S)-2-amino-4-deoxy-chorismic acid
2-Amino-2-deoxyisochorismate
2-amino-2-deoxy-isochorismate
2-amino-2-deoxy-isochorismic acid
2-amino-4-deoxy-chorismate
2-amino-4-deoxy-chorismic acid
a4dic
keggC:M_C18054
seedM:M_cpd17073
seedM:M_cpd18037
secondary/obsolete/fantasy identifier