Feedback

dopamine

PropertiesImageOccurences in reactions
MNX_IDMNXM205Image of MNXM205
#reac
in my sandbox 0
in MNXref (generic)54
in models (compartimentalized) 33
formulaC8H12NO2
charge1
mass154.18642
referencechebi:59905
InChIKeyVYFYYTLLBUKUHU-UHFFFAOYSA-O
InChIInChI=1S/C8H11NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,10-11H,3-4,9H2/p+1
SMILES[NH3+]CCc1ccc(O)c(O)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:59905
chebi:59905
dopamine
2-(3,4-dihydroxyphenyl)ethan-1-aminium
2-(3,4-dihydroxyphenyl)ethanaminium
dopaminium cation
dopaminium(1+)
sabiork.compound:20037
sabiorkM:20037
3,4-Dihydroxyphenethylamine
bigg.metabolite:dopa
biggM:dopa
Dopamine
kegg.drug:D07870
keggD:D07870
Dopamine (INN)
Medopa (TN)
seed.compound:cpd02357
seedM:cpd02357
Dopamine
2-(3,4-Dihydroxyphenyl)ethylamine
2-(3,4-dihydroxyphenyl)ethylamine
3,4-Dihydroxyphenethylamine
3,4-dihydroxyphenethylamine
3-hydroxytyramine
4-(2-Aminoethyl)-1,2-benzenediol
4-(2-Aminoethyl)benzene-1,2-diol
4-(2-aminoethyl)benzene-1,2-diol
deoxyepinephrine
dopa
dopamine
hydroxytyramine
intropin
hmdb:HMDB0000073 Dopamine
2-(3,4-Dihydroxyphenyl)ethylamine
3,4 Dihydroxyphenethylamine
3,4-Dihydroxyphenethylamine
3,4-Dihydroxyphenylethylamine
3-Hydroxytyramine
4-(2-Aminoethyl)-1,2-benzenediol
4-(2-Aminoethyl)-pyrocatechol
4-(2-Aminoethyl)benzene-1,2-diol
4-(2-Aminoethyl)catechol
4-(2-Aminoethyl)pyrocatechol
4-(2-aminoethyl)benzene-1,2-diol
Deoxyepinephrine
Dopamin
Dopamina
Dopamine hydrochloride
Dopaminum
Dopastat
Dophamine
Dynatra
Hydrochloride, dopamine
Hydroxytyramin
Hydroxytyramine
Intropin
Oxytyramine
Revivan
a-(3,4-Dihydroxyphenyl)-b-aminoethane
alpha-(3,4-Dihydroxyphenyl)-beta-aminoethane
dopamine
kegg.compound:C03758
keggC:C03758
Dopamine
2-(3,4-Dihydroxyphenyl)ethylamine
3,4-Dihydroxyphenethylamine
4-(2-Aminoethyl)-1,2-benzenediol
4-(2-Aminoethyl)benzene-1,2-diol
sabiork.compound:6836
sabiorkM:6836
Dopamine
2-(3,4-Dihydroxyphenyl)ethylamine
4-(2-Aminoethyl)-1,2-benzenediol
4-(2-Aminoethyl)benzene-1,2-diol
envipath:...b97abf5dc03c
envipathM:...b97abf5dc03c
compound 44331
reactome:R-ALL-159362
reactomeM:R-ALL-159362
reactome:R-ALL-351601
reactomeM:R-ALL-351601
reactome:R-ALL-380873
reactomeM:R-ALL-380873
CHEBI:18243
chebi:18243
dopamine
2-(3,4-Dihydroxyphenyl)ethylamine
2-(3,4-dihydroxyphenyl)ethylamine
3,4-Dihydroxyphenethylamine
3-Hydroxytyramine
4-(2-Aminoethyl)-1,2-benzenediol
4-(2-Aminoethyl)benzene-1,2-diol
4-(2-aminoethyl)-1,2-benzenediol
4-(2-aminoethyl)benzene-1,2-diol
4-(2-aminoethyl)catechol
4-(2-aminoethyl)pyrocatechol
Deoxyepinephrine
Dopamine
Hydroxytyramin
dopamina
dopaminum
metacyc.compound:DOPAMINE
metacycM:DOPAMINE
dopamine
2-(3,4-dihydroxyphenyl)ethylamine
3,4-dihydroxyphenethylamine
3-hydroxytyramine
4-(2-aminoethyl)benzene-1,2-diol
deoxyepinephrine
hydroxytyramine
intropin
hmdb:HMDB00073
chebi:11695
chebi:11930
chebi:14203
chebi:1764
chebi:23886
chebi:43686
biggM:M_dopa
keggC:M_C03758
keggD:M_D07870
seedM:M_cpd02357
secondary/obsolete/fantasy identifier