Feedback

(5Z,8Z,11Z,13E,15S)-hydroxyeicosatetraenoate

Properties
MNX_IDMNXM2059
formulaC20H31O3
charge-1
mass319.45834
referencechebi:57409
Image of MNXM2059
InChIKeyJSFATNQSLKRBCI-VAEKSGALSA-M
InChIInChI=1S/C20H32O3/c1-2-3-13-16-19(21)17-14-11-9-7-5-4-6-8-10-12-15-18-20(22)23/h4-5,8-11,14,17,19,21H,2-3,6-7,12-13,15-16,18H2,1H3,(H,22,23)/p-1/b5-4-,10-8-,11-9-,17-14+/t19-/m0/s1
SMILESCCCCC[C@H](O)\C=C\C=C/C\C=C/C\C=C/CCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref11
Distinct compatimentalized reactions in models1

Similar chemical compounds in external resources
IdentifierDescription
lipidmaps:LMFA03060001 15S-HETE
15S-hydroxy-5Z,8Z,11Z,13E-eicosatetraenoic acid
FA(20:4(OH))
seedM:cpd02890 15(S)-HETE
(15S)-15-Hydroxy-5,8,11-cis-13-trans-eicosatetraenoate
(15S)-15-Hydroxy-5,8,11-cis-13-trans-icosatetraenoate
(15S)-15-hydroxy-5,8,11-cis-13-trans-eicosatetraenoate
(15S)-15-hydroxy-5,8,11-cis-13-trans-icosatetraenoate
(5Z,8Z,11Z,13E)-(15S)-15-Hydroxyicosa-5,8,11,13-tetraenoic acid
(5Z,8Z,11Z,13E,15S)-15-hydroxy-eicosa-5,8,11,13-tetraenoate
(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoate
15-hydroxy-eicosa-5,8,11,13-tetraenoate
15S-hydroxypentaenoate
keggD:D08931 Icomucret (USAN)
metacycM:CPD66-55 (15S)-hydroxyarachidonate
(15S)-15-hydroxy-5,8,11-cis-13-trans-eicosatetraenoate
(15S)-15-hydroxy-5,8,11-cis-13-trans-icosatetraenoate
(5Z,8Z,11Z,13E,15S)-15-hydroxy-eicosa-5,8,11,13-tetraenoate
(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoate
15-hydroxy-eicosa-5,8,11,13-tetraenoate
hmdb:HMDB0003876 15(S)-HETE
(15S)-15-Hydroxy-5,8,11-cis-13-trans-eicosatetraenoate
(15S)-15-Hydroxy-5,8,11-cis-13-trans-eicosatetraenoic acid
(15S)-15-Hydroxy-5,8,11-cis-13-trans-eicosic acid
(15S)-15-Hydroxy-5,8,11-cis-13-trans-icosatetraenoate
(15S)-15-Hydroxy-5,8,11-cis-13-trans-icosatetraenoic acid
(15S)-Hydroxy-(5Z,8Z,11Z,13E)-eicosatetraenoate
(15S)-Hydroxy-(5Z,8Z,11Z,13E)-eicosatetraenoic acid
(15S)-Hydroxyeicosa-(5Z,8Z,11Z,13E)-tetraenoate
(15S)-Hydroxyeicosa-(5Z,8Z,11Z,13E)-tetraenoic acid
(15S,5Z,8Z,11Z,13E)-15-Hydroxyeicosatetraenoate
(15S,5Z,8Z,11Z,13E)-15-Hydroxyeicosatetraenoic acid
(5Z,8Z,11Z,13E)-(15S)-15-Hydroxyicosa-5,8,11,13-tetraenoate
(5Z,8Z,11Z,13E)-(15S)-15-Hydroxyicosa-5,8,11,13-tetraenoic acid
(5Z,8Z,11Z,13E,15S)-15-Hydroxy-5,8,11,13-eicosatetraenoate
(5Z,8Z,11Z,13E,15S)-15-Hydroxy-5,8,11,13-eicosatetraenoic acid
(5Z,8Z,11Z,13E,15S)-15-Hydroxyeicosa-5,8,11,13-tetraenoate
(5Z,8Z,11Z,13E,15S)-15-Hydroxyeicosa-5,8,11,13-tetraenoic acid
(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoic acid
(S)-15-HETE
15 Hete
15 hete
15(S)-Hydroxy-(5Z,8Z,11Z,13E)-eicosatetraenoate
15(S)-Hydroxy-(5Z,8Z,11Z,13E)-eicosatetraenoic acid
15(S)-Hydroxyeicosatetraenoate
15(S)-Hydroxyeicosatetraenoic acid
15-HETE
15-Hydroxy-5,8,11,13-eicosatetraenoic acid
15-Hydroxy-5,8,11,13-eicosatetraenoic acid, (S-(e,Z,Z,Z))-isomer
15S-HETE
15S-Hydroxy-5Z,8Z,11Z,13E-eicosatetraenoate
15S-Hydroxy-5Z,8Z,11Z,13E-eicosatetraenoic acid
Icomucret
chebi:10824
chebi:147
chebi:18507
hmdb:HMDB0002110
hmdb:HMDB02110
hmdb:HMDB03876
keggC:M_C04742
keggD:M_D08931
seedM:M_cpd02890
secondary/obsolete/fantasy identifier
chebi:57409 (5Z,8Z,11Z,13E,15S)-hydroxyeicosatetraenoate
(15S)-hydroxy-(5Z,8Z,11Z,13E)-eicosatetraenoate
(15S)-hydroxyeicosa-(5Z,8Z,11Z,13E)-tetraenoate
(5Z,8Z,11Z,13E,15S)-15-hydroxy-5,8,11,13-eicosatetraenoate
(5Z,8Z,11Z,13E,15S)-15-hydroxyeicosa-5,8,11,13-tetraenoate
(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoate
15(S)-HETE(1-)
15(S)-hydroxyeicosatetraenoate
slm:000500469 (15S)-hydroxy-(5Z,8Z,11Z,13E)-eicosatetraenoate
(15S)-H-(5Z,8Z,11Z,13E)-ETE
(15S)-HETE
keggC:C04742 (15S)-15-Hydroxy-5,8,11-cis-13-trans-eicosatetraenoate
(15S)-15-Hydroxy-5,8,11-cis-13-trans-icosatetraenoate
(5Z,8Z,11Z,13E)-(15S)-15-Hydroxyicosa-5,8,11,13-tetraenoic acid
15(S)-HETE
chebi:15558
reactome:R-ALL-2142707
15(S)-HETE
(15S)-15-Hydroxy-5,8,11-cis-13-trans-eicosatetraenoate
(15S)-15-Hydroxy-5,8,11-cis-13-trans-icosatetraenoate
(15S)-15-hydroxy-5,8,11-cis-13-trans-eicosatetraenoate
(15S)-15-hydroxy-5,8,11-cis-13-trans-icosatetraenoate
(15S)-hydroxy-(5Z,8Z,11Z,13E)-eicosatetraenoic acid
(15S)-hydroxyeicosa-(5Z,8Z,11Z,13E)-tetraenoic acid
(5Z,8Z,11Z,13E)-(15S)-15-Hydroxyicosa-5,8,11,13-tetraenoic acid
(5Z,8Z,11Z,13E,15S)-15-hydroxy-5,8,11,13-eicosatetraenoic acid
(5Z,8Z,11Z,13E,15S)-15-hydroxyeicosa-5,8,11,13-tetraenoic acid
(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoic acid
15(S)-hydroxyeicosatetraenoic acid
15S-HETE
icomucret
MNXM101462is deprecated and replaced by this entry