Feedback

(2R)-2-O-(alpha-D-glucopyranosyl)-glycerate

PropertiesImageOccurences in reactions
MNX_IDMNXM2070Image of MNXM2070
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 0
formulaC9H15O9
charge-1
mass267.21
referencechebi:62510
InChIKeyDDXCFDOPXBPUJC-CECBSOHTSA-M
InChIInChI=1S/C9H16O9/c10-1-3-5(12)6(13)7(14)9(17-3)18-4(2-11)8(15)16/h3-7,9-14H,1-2H2,(H,15,16)/p-1/t3-,4-,5-,6+,7-,9-/m1/s1
SMILESOC[C@@H](O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:62510
chebi:62510
(2R)-2-O-(alpha-D-glucopyranosyl)-glycerate
(2R)-2-(alpha-D-glucopyranosyloxy)-3-hydroxypropanoate
(R)-2-O-alpha-D-glucopyranosyl glycerate
2-O-(alpha-D-glucopyranosyl)-D-glycerate
O-alpha-D-glucopyranosyl-(1->2)-D-glycerate
kegg.compound:C19792
keggC:C19792
2-O-(alpha-D-Glucopyranosyl)-D-glycerate
(R)-2-(alpha-D-Glucopyranosyloxy)-3-hydroxypropanoate
seed.compound:cpd21037
seedM:cpd21037
2-O-(alpha-D-Glucopyranosyl)-D-glycerate
(R)-2-(alpha-D-Glucopyranosyloxy)-3-hydroxypropanoate
(R)-2-(alpha-D-glucopyranosyloxy)-3-hydroxypropanoate
2-(alpha-D-glucopyranosyl)-D-glycerate
2-O-(alpha-D-glucopyranosyl)-D-glycerate
metacyc.compound:CPD-9190
metacycM:CPD-9190
2-O-(alpha-D-glucopyranosyl)-D-glycerate
2-(alpha-D-glucopyranosyl)-D-glycerate
glucosylglycerate
CHEBI:62509
chebi:62509
2-O-(alpha-D-glucopyranosyl)-D-glyceric acid
(2R)-2-(alpha-D-glucopyranosyloxy)-3-hydroxypropanoic acid
(R)-2-O-alpha-D-glucopyranosyl glyceric acid
D-glyceric acid 2-O-(alpha-D-glucopyranoside)
O-alpha-D-glucopyranosyl-(1->2)-D-glyceric acid
keggC:M_C19792
seedM:M_cpd21037
secondary/obsolete/fantasy identifier