Feedback

2-oxodecanoate

Properties
MNX_IDMNXM2071
formulaC18H33O3
charge-1
mass297.45282
referencechebi:17162
Image of MNXM2071
InChIKeyJUCAMRNDACLKGY-UHFFFAOYSA-M
InChIInChI=1S/C18H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21/h2-16H2,1H3,(H,20,21)/p-1
SMILESCCCCCCCCCCCCCCCCC(=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
keggC:C00869 2-Oxooctadecanoic acid
2-Oxostearate
chebi:17162 2-oxodecanoate
2-oxooctadecanoate
2-oxostearate
metacycM:2-OXOSTEARATE 2-oxostearate
chebi:30820 2-oxooctadecanoic acid
2-Oxooctadecanoic acid
2-oxo-octadecanoic acid
2-oxostearic acid
chebi:11645
chebi:1260
chebi:19755
chebi:19756
keggC:M_C00869
seedM:M_cpd00645
secondary/obsolete/fantasy identifier
lipidmaps:LMFA02000262 2-oxo-octadecanoic acid
2-oxo-octadecanoic acid
FA(18:0(Ke))
seedM:cpd00645 2-Oxostearate
2-Oxooctadecanoic acid
2-oxostearate