Feedback

2-oxooctadecanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2071Image of MNXM2071
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC18H33O3
charge-1
mass297.24352
referencechebi:17162
InChIKeyJUCAMRNDACLKGY-UHFFFAOYSA-M
InChIInChI=1S/C18H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21/h2-16H2,1H3,(H,20,21)/p-1
SMILESCCCCCCCCCCCCCCCCC(=O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17162
chebi:17162
2-oxooctadecanoate
2-oxostearate
kegg.compound:C00869
keggC:C00869
2-Oxooctadecanoic acid
2-Oxostearate
seed.compound:cpd00645
seedM:cpd00645
2-Oxostearate
2-Oxooctadecanoic acid
2-oxostearate
lipidmaps:LMFA02000262
lipidmapsM:LMFA02000262
2-oxo-octadecanoic acid
2-oxo-octadecanoic acid
FA 18:1
O
CHEBI:30820
chebi:30820
2-oxooctadecanoic acid
2-Oxooctadecanoic acid
2-oxo-octadecanoic acid
2-oxostearic acid
metacyc.compound:2-OXOSTEARATE
metacycM:2-OXOSTEARATE
2-oxostearate
chebi:11645
chebi:1260
chebi:19755
chebi:19756
keggC:M_C00869
seedM:M_cpd00645
secondary/obsolete/fantasy identifier