Feedback

2-oxosuccinamate

PropertiesImageOccurences in reactions
MNX_IDMNXM2072Image of MNXM2072
#reac
in my sandbox 0
in MNXref (generic)14
in models (compartimentalized) 0
formulaC4H4NO4
charge-1
mass130.0789
referencechebi:57735
InChIKeyONGPAWNLFDCRJE-UHFFFAOYSA-M
InChIInChI=1S/C4H5NO4/c5-3(7)1-2(6)4(8)9/h1H2,(H2,5,7)(H,8,9)/p-1
SMILESNC(=O)CC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57735
chebi:57735
2-oxosuccinamate
3-carbamoyl-2-oxopropanoate
4-amino-2,4-dioxobutanoate
seed.compound:cpd01577
seedM:cpd01577
2-Oxosuccinamate
2-Oxosuccinamic acid
2-oxosuccinamate
L-keto-succinamate
L-oxosuccinamate
Oxaloacetamid
Oxaloacetamide
alpha-ketosuccinamate
gamma-Aminooxaloacetate
ketosuccinamate
kegg.compound:C02362
keggC:C02362
2-Oxosuccinamate
2-Oxosuccinamic acid
Oxaloacetamide
gamma-Aminooxaloacetate
hmdb:HMDB0060350 2-Oxosuccinamate
3-(C-hydroxycarbonimidoyl)-2-oxopropanoic acid
Oxaloacetamid
g-Aminooxaloacetate
g-Aminooxaloacetic acid
gamma-Aminooxaloacetate
gamma-Aminooxaloacetic acid
gamma-aminooxaloacetate
gamma-aminooxaloacetic acid
oxaloacetamide
sabiork.compound:6162
sabiorkM:6162
2-Oxosuccinamate
alpha-Ketosuccinamate
metacyc.compound:2-OXOSUCCINAMATE
metacycM:2-OXOSUCCINAMATE
2-oxosuccinamate
L-keto-succinamate
L-oxosuccinamate
alpha-ketosuccinamate
ketosuccinamate
CHEBI:16327
chebi:16327
2-oxosuccinamic acid
2-Oxosuccinamate
2-Oxosuccinamic acid
4-amino-2,4-dioxobutanoic acid
Oxaloacetamid
gamma-Aminooxaloacetate
hmdb:HMDB60350
chebi:11646
chebi:1261
chebi:19757
keggC:M_C02362
seedM:M_cpd01577
secondary/obsolete/fantasy identifier