Feedback

2-phosphoglycolate

PropertiesImageOccurences in reactions
MNX_IDMNXM2074Image of MNXM2074
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 9
formulaC2H2O6P
charge-3
mass153.007441
referencechebi:58033
InChIKeyASCFNMCAHFUBCO-UHFFFAOYSA-K
InChIInChI=1S/C2H5O6P/c3-2(4)1-8-9(5,6)7/h1H2,(H,3,4)(H2,5,6,7)/p-3
SMILES[O-]C(=O)COP([O-])([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58033
chebi:58033
2-phosphoglycolate
(phosphonatooxy)acetate
2-(phosphonatooxy)acetate
2-phosphonatoglycolate
2-phosphonatoglycolate trianion
2-phosphonatoglycolate(3-)
bigg.metabolite:2pglyc
biggM:2pglyc
2-Phosphoglycolate
seed.compound:cpd00727
seedM:cpd00727
2-Phosphoglycolate
2-P-glycolate
2-phosphoglycolate
2pglyc
Phosphoglycolic acid
phosphoglycolate
sabiork.compound:1350
sabiorkM:1350
2-Phosphoglycolate
Phosphoglycolate
Phosphoglycolic acid
kegg.compound:C00988
keggC:C00988
2-Phosphoglycolate
Phosphoglycolic acid
CHEBI:19763
chebi:19763
2-phosphoglycolate
metacyc.compound:CPD-67
metacycM:CPD-67
2-phosphoglycolate
2-P-glycolate
Phosphoglycolic acid
phosphoglycolate
CHEBI:17150
chebi:17150
2-phosphoglycolic acid
(phosphonooxy)acetic acid
2-Phosphoglycolate
Phosphoglycolic acid
hmdb:HMDB0000816 Phosphoglycolic acid
(Phosphonooxy)-acetate
(Phosphonooxy)-acetic acid
(Phosphonooxy)acetate
(Phosphonooxy)acetic acid
2-(phosphonooxy)acetic acid
2-Phosphoglicolate
2-Phosphoglycolate
2-Phosphoglycolic acid
2-Phosphonatoglycolate
Glycolate-2-P
Glycolic acid di-H phosphate
Glycolic acid dihydrogen phosphate
Glycolic acid phosphate
Glycophosphorate
Glycophosphoric acid
Phosphoglycolate
phosphoglycolate
hmdb:HMDB0060148
hmdb:HMDB00816
hmdb:HMDB60148
chebi:11652
chebi:1268
chebi:19764
chebi:44849
biggM:M_2pglyc
keggC:M_C00988
seedM:M_cpd00727
secondary/obsolete/fantasy identifier