Feedback

3-hydroxy-3-(4-methylpent-3-en-1-yl)glutaryl-CoA

PropertiesImageOccurences in reactions
MNX_IDMNXM2078Image of MNXM2078
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 0
formulaC32H47N7O20P3S
charge-5
mass974.738043
referencechebi:57341
InChIKeyATTJZXQHBIJXLV-AWVQIHIZSA-I
InChIInChI=1S/C32H52N7O20P3S/c1-18(2)6-5-8-32(47,12-21(41)42)13-22(43)63-11-10-34-20(40)7-9-35-29(46)26(45)31(3,4)15-56-62(53,54)59-61(51,52)55-14-19-25(58-60(48,49)50)24(44)30(57-19)39-17-38-23-27(33)36-16-37-28(23)39/h6,16-17,19,24-26,30,44-45,47H,5,7-15H2,1-4H3,(H,34,40)(H,35,46)(H,41,42)(H,51,52)(H,53,54)(H2,33,36,37)(H2,48,49,50)/p-5/t19-,24-,25-,26+,30-,32?/m1/s1
SMILESCC(C)=CCCC(O)(CC([O-])=O)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP([O-])([O-])=O)n1cnc2c(N)ncnc12
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57341
chebi:57341
3-hydroxy-3-(4-methylpent-3-en-1-yl)glutaryl-CoA
3'-phosphonatoadenosine 5'-{3-[(3R)-4-({3-[(2-{[3-(carboxylatomethyl)-3-hydroxy-7-methyloct-6-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] diphosphate}
3-hydroxy-3-(4-methylpent-3-en-1-yl)glutaryl-CoA(5-)
kegg.compound:C04675
keggC:C04675
3-Hydroxy-3-(4-methylpent-3-en-1-yl)glutaryl-CoA
3-Hydroxy-3-isohexeneylglutaryl-CoA
hmdb:HMDB0060372 3-Hydroxy-3-(4-methylpent-3-en-1-yl)glutaryl-CoA
3-Hydroxy-3-isohexeneylglutaryl-CoA
3-[2-({2-[(3-{[(2R)-4-({[({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)oxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)-1,2-dihydroxy-3,3-dimethylbutylidene]amino}-1-hydroxypropylidene)amino]ethyl}sulfanyl)-2-oxoethyl]-3-hydroxy-7-methyloct-6-enoic acid
3-[2-({2-[(3-{[(2R)-4-[({[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(phosphonooxy)oxolan-2-yl]methoxy(hydroxy)phosphoryl}oxy(hydroxy)phosphoryl)oxy]-1,2-dihydroxy-3,3-dimethylbutylidene]amino}-1-hydroxypropylidene)amino]ethyl}sulfanyl)-2-oxoethyl]-3-hydroxy-7-methyloct-6-enoic acid
seed.compound:cpd02849
seedM:cpd02849
3-Hydroxy-3-(4-methylpent-3-en-1-yl)glutaryl-CoA
3-Hydroxy-3-isohexeneylglutaryl-CoA
3-hydroxy-3-(4-methylpent-3-en-1-yl)glutaryl-CoA
3-hydroxy-3-isohexenyl-glutaryl-CoA
CHEBI:15483
chebi:15483
3-hydroxy-3-(4-methylpent-3-en-1-yl)glutaryl-CoA
3'-phosphoadenosine 5'-{3-[(3R)-4-({3-[(2-{[3-(carboxymethyl)-3-hydroxy-7-methyloct-6-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate}
3-Hydroxy-3-(4-methylpent-3-en-1-yl)glutaryl-CoA
lipidmaps:LMFA07050207
lipidmapsM:LMFA07050207
3-hydroxy-3-(4-methylpent-3-en-1-yl)glutaryl-CoA
3'-phosphoadenosine 5'-{3-[(3R)-4-({3-[(2-{[3-(carboxymethyl)-3-hydroxy-7-methyloct-6-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate}
CoA(11:1(OH))
metacyc.compound:3-HYDROXY-3-4-METHYLPENT-3-EN-1-YLG-COA
metacycM:3-HYDROXY-3-4-METHYLPENT-3-EN-1-YLG-COA
3-hydroxy-3-(4-methylpent-3-en-1-yl)glutaryl-CoA
3-hydroxy-3-isohexenyl-glutaryl-CoA
hmdb:HMDB60372
chebi:11810
chebi:11811
chebi:1521
chebi:20040
keggC:M_C04675
seedM:M_cpd02849
secondary/obsolete/fantasy identifier