Feedback

4-(4-Deoxy-alpha-D-gluc-4-enuronosyl)-D-galacturonate

PropertiesImageOccurences in reactions
MNX_IDMNXM2081Image of MNXM2081
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 0
formulaC12H14O12
charge-2
mass350.23236
referencekeggC:C06118
InChIKeyLLVVMXFNKAHVEZ-KMBKDFKYSA-L
InChIInChI=1S/C12H16O12/c13-2-1-3(9(17)18)22-12(4(2)14)24-7-5(15)6(16)11(21)23-8(7)10(19)20/h1-2,4-8,11-16,21H,(H,17,18)(H,19,20)/p-2/t2-,4+,5+,6+,7+,8-,11+,12+/m0/s1
SMILESO[C@@H]1O[C@@H]([C@H](O[C@H]2OC(=C[C@H](O)[C@H]2O)C([O-])=O)[C@H](O)[C@H]1O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
kegg.compound:C06118
keggC:C06118
4-(4-Deoxy-alpha-D-gluc-4-enuronosyl)-D-galacturonate
4-(4-Deoxy-alpha-D-galact-4-enuronosyl)-D-galacturonate
Unsaturated digalacturonate
seed.compound:cpd03648
seedM:cpd03648
4-(4-Deoxy-alpha-D-gluc-4-enuronosyl)-D-galacturonate
4-(4-Deoxy-alpha-D-galact-4-enuronosyl)-D-galacturonate
4-(4-deoxy-alpha-D-galact-4-enuronosyl)-D-galacturonate
4-(4-deoxy-alpha-D-gluc-4-enosyluronic acid)-D-galacturonic acid
4-(4-deoxy-alpha-D-gluc-4-enuronosyl)-D-galacturonate
4-O-(4-deoxy-beta-L-threo-hex-4-enopyranosyluronic acid)-D-galactopyranuronic acid
Unsaturated digalacturonate
unsaturated digalacturonate
CHEBI:60189
chebi:60189
4-(4-deoxy-alpha-D-galact-4-enuronosyl)-D-galacturonate
4-(4-deoxy-alpha-D-galact-4-enosyluronic acid)-D-galacturonate dianion
4-(4-deoxy-alpha-D-galact-4-enosyluronic acid)-D-galacturonate(2-)
4-(4-deoxy-alpha-D-galact-4-enuronosyl)-D-galacturonate dianion
4-(4-deoxy-alpha-D-galact-4-enuronosyl)-D-galacturonate(2-)
4-(4-deoxy-alpha-D-gluc-4-enosyluronic acid)-D-galacturonate dianion
4-(4-deoxy-alpha-D-gluc-4-enosyluronic acid)-D-galacturonate(2-)
4-O-(4-deoxy-beta-L-threo-hex-4-enopyranuronosyl)-D-galactopyranuronate
metacyc.compound:CPD-11241
metacycM:CPD-11241
4-(4-deoxy-alpha-D-galact-4-enuronosyl)-D-galacturonate
4-(4-deoxy-alpha-D-gluc-4-enosyluronic acid)-D-galacturonic acid
4-(4-deoxy-alpha-D-gluc-4-enuronosyl)-D-galacturonate
4-(4-deoxy-beta-D-gluc-4-enuronosyl)-D-galacturonate
4-(4-deoxy-beta-D-gluc-4-enuronosyl)-galacturonate
4-O-(4-deoxy-beta-L-threo-hex-4-enopyranosyluronic acid)-D-galactopyranuronic acid
unsaturated digalacturonate
CHEBI:27450
chebi:27450
4-(4-deoxy-alpha-D-gluc-4-enosyluronic acid)-D-galacturonic acid
4-(4-Deoxy-alpha-D-galact-4-enuronosyl)-D-galacturonate
4-(4-Deoxy-alpha-D-gluc-4-enuronosyl)-D-galacturonate
4-(4-deoxy-alpha-D-galact-4-enosyluronic acid)-D-galacturonic acid
4-O-(4-deoxy-beta-L-threo-hex-4-enopyranosyluronic acid)-D-galactopyranuronic acid
Unsaturated digalacturonate
kegg.glycan:G10113
keggG:G10113
G10113
chebi:1767
chebi:1769
chebi:20289
chebi:20290
chebi:28551
keggC:M_C06118
keggG:M_G10113
seedM:M_cpd03648
secondary/obsolete/fantasy identifier