Feedback

4-acetamidobutanoate

Properties
MNX_IDMNXM2083
formulaC6H10NO3
charge-1
mass144.14854
referencechebi:11951
Image of MNXM2083
InChIKeyUZTFMUBKZQVKLK-UHFFFAOYSA-M
InChIInChI=1S/C6H11NO3/c1-5(8)7-4-2-3-6(9)10/h2-4H2,1H3,(H,7,8)(H,9,10)/p-1
SMILESCC(=O)NCCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref3
Distinct compatimentalized reactions in models4

Similar chemical compounds in external resources
IdentifierDescription
chebi:17645 4-acetamidobutanoic acid
4-(acetylamino)butanoic acid
4-Acetamidobutyric acid
N-Acetyl-4-aminobutanoic acid
N-Acetyl-4-aminobutyric acid
N4-Acetylaminobutanoic acid
metacycM:CPD-35 4-acetamidobutanoate
N-acetyl-4-aminobutyrate
N-acetyl-gamma-aminobutyrate
hmdb:HMDB0003681 4-Acetamidobutanoic acid
4-(acetylamino)Butanoate
4-(acetylamino)Butanoic acid
4-Acetamidobutanoate
4-Acetamidobutyrate
4-Acetamidobutyric acid
4-acetamidobutanoic acid
4-acetamidobutyrate
N-Acetyl-4-aminobutanoate
N-Acetyl-4-aminobutanoic acid
N-Acetyl-4-aminobutyrate
N-Acetyl-4-aminobutyric acid
N-Acetyl-gaba
N-Acetyl-gamma-amino-N-butyric acid
N-Acetyl-gamma-aminobutyrate
N4-Acetylaminobutanoate
N4-Acetylaminobutanoic acid
seedM:cpd01889 4-Acetamidobutanoate
4-acetamidobutanoate
4aabutn
N-acetyl-4-aminobutyrate
N-acetyl-gamma-aminobutyrate
N4-Acetylaminobutanoate
chebi:11951 4-acetamidobutanoate
N-acetyl-4-aminobutyrate
N-acetyl-gamma-aminobutyrate
N4-Acetylaminobutanoate
keggC:C02946
sabiorkM:2601
4-Acetamidobutanoate
N4-Acetylaminobutanoate
biggM:M_4aabutn
chebi:1777
chebi:20303
hmdb:HMDB0006238
hmdb:HMDB0060265
hmdb:HMDB03681
hmdb:HMDB06238
hmdb:HMDB60265
keggC:M_C02946
seedM:M_cpd01889
secondary/obsolete/fantasy identifier
biggM:4aabutn 4 Acetamidobutanoate