Feedback

4-hydroxyphenylglyoxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM2085Image of MNXM2085
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 0
formulaC8H5O4
charge-1
mass165.01933
referencechebi:58586
InChIKeyKXFJZKUFXHWWAJ-UHFFFAOYSA-M
InChIInChI=1S/C8H6O4/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,9H,(H,11,12)/p-1
SMILESO=C([O-])C(=O)c1ccc(O)cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58586
chebi:58586
4-hydroxyphenylglyoxylate
(4-hydroxyphenyl)(oxo)acetate
seed.compound:cpd02259
seedM:cpd02259
4-Hydroxybenzoylformate
2-(4-Hydroxyphenyl)-2-oxoacetate
2-(4-hydroxyphenyl)-2-oxo-acetic acid
2-(4-hydroxyphenyl)-2-oxoacetate
4-Hydroxyphenylglyoxylate
4-Hydroxyphenylglyoxylic acid
4-hydroxybenzoylformate
4-hydroxyphenylglyoxylate
p-hydroxybenzoylformate
kegg.compound:C03590
keggC:C03590
4-Hydroxyphenylglyoxylate
2-(4-Hydroxyphenyl)-2-oxoacetate
4-Hydroxybenzoylformate
4-Hydroxyphenylglyoxylic acid
metacyc.compound:CPD-142
metacycM:CPD-142
4-hydroxyphenylglyoxylate
2-(4-hydroxyphenyl)-2-oxo-acetic acid
2-(4-hydroxyphenyl)-2-oxoacetate
4-hydroxybenzoylformate
p-hydroxybenzoylformate
CHEBI:28719
chebi:28719
4-hydroxyphenylglyoxylic acid
(4-hydroxyphenyl)(oxo)acetic acid
4-Hydroxybenzoylformate
4-Hydroxyphenylglyoxylate
4-Hydroxyphenylglyoxylic acid
4-hydroxybenzoylformate
4-hydroxyphenylglyoxylate
Pisolithin A
chebi:12000
chebi:1880
chebi:20424
keggC:M_C03590
seedM:M_cpd02259
secondary/obsolete/fantasy identifier