Feedback

4-hydroxyphenylglyoxylate

Properties
MNX_IDMNXM2085
formulaC8H5O4
charge-1
mass165.1229
referencechebi:58586
Image of MNXM2085
InChIKeyKXFJZKUFXHWWAJ-UHFFFAOYSA-M
InChIInChI=1S/C8H6O4/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,9H,(H,11,12)/p-1
SMILESOc1ccc(cc1)C(=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref9
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:28719 4-hydroxyphenylglyoxylic acid
(4-hydroxyphenyl)(oxo)acetic acid
4-Hydroxybenzoylformate
4-Hydroxyphenylglyoxylate
4-Hydroxyphenylglyoxylic acid
4-hydroxybenzoylformate
4-hydroxyphenylglyoxylate
Pisolithin A
keggC:C03590 4-Hydroxyphenylglyoxylate
2-(4-Hydroxyphenyl)-2-oxoacetate
4-Hydroxybenzoylformate
4-Hydroxyphenylglyoxylic acid
chebi:58586 4-hydroxyphenylglyoxylate
(4-hydroxyphenyl)(oxo)acetate
metacycM:CPD-142 2-(4-hydroxyphenyl)-2-oxoacetate
2-(4-hydroxyphenyl)-2-oxo-acetic acid
4-hydroxybenzoylformate
4-hydroxyphenylglyoxylate
p-hydroxybenzoylformate
chebi:12000
chebi:1880
chebi:20424
keggC:M_C03590
seedM:M_cpd02259
secondary/obsolete/fantasy identifier
seedM:cpd02259 4-Hydroxybenzoylformate
2-(4-Hydroxyphenyl)-2-oxoacetate
2-(4-hydroxyphenyl)-2-oxo-acetic acid
2-(4-hydroxyphenyl)-2-oxoacetate
4-Hydroxyphenylglyoxylate
4-Hydroxyphenylglyoxylic acid
4-hydroxybenzoylformate
4-hydroxyphenylglyoxylate
p-hydroxybenzoylformate