|
![]() |
InChIKey | RCCMXKJGURLWPB-BYPYZUCNSA-M |
InChI | InChI=1S/C6H9NO4/c1-3(5(8)9)2-4(7)6(10)11/h4H,1-2,7H2,(H,8,9)(H,10,11)/p-1/t4-/m0/s1 |
SMILES | [NH3+][C@@H](CC(=C)C([O-])=O)C([O-])=O |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 3 |
Distinct compatimentalized reactions in models | 0 |
Identifier | Description |
---|---|
metacycM:CPD-1774 | 4-methylene-L-glutamate |
chebi:17299 | 4-methylene-L-glutamate(2-) (2S)-2-amino-4-methylenepentanedioate (2S)-2-amino-4-methylidenepentanedioate |
chebi:12026 chebi:1899 chebi:20444 chebi:20445 keggC:M_C00651 seedM:M_cpd00495 | secondary/obsolete/fantasy identifier |
chebi:58733 | 4-methylene-L-glutamate (2S)-2-azaniumyl-4-methylenepentanedioate 4-methylene-L-glutamate(1-) |
chebi:48031 | 4-methylene-L-glutamic acid (2S)-2-amino-4-methylidenepentanedioic acid 4-Methylene-L-glutamate 4-methylidene-L-glutamic acid |
seedM:cpd00495 | 4-Methylene-L-glutamate 4-methylene-L-glutamate |
keggC:C00651 | 4-Methylene-L-glutamate |
MNXM91439 | is deprecated and replaced by this entry |
MNXM92001 | is deprecated and replaced by this entry |