Feedback

4-methylene-L-glutamate

PropertiesImageOccurences in reactions
MNX_IDMNXM2086Image of MNXM2086
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC6H8NO4
charge-1
mass158.13206
referencechebi:58733
InChIKeyRCCMXKJGURLWPB-BYPYZUCNSA-M
InChIInChI=1S/C6H9NO4/c1-3(5(8)9)2-4(7)6(10)11/h4H,1-2,7H2,(H,8,9)(H,10,11)/p-1/t4-/m0/s1
SMILES[NH3+][C@@H](CC(=C)C([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58733
chebi:58733
4-methylene-L-glutamate
(2S)-2-azaniumyl-4-methylenepentanedioate
4-methylene-L-glutamate(1-)
kegg.compound:C00651
keggC:C00651
4-Methylene-L-glutamate
seed.compound:cpd00495
seedM:cpd00495
4-Methylene-L-glutamate
4-methylene-L-glutamate
metacyc.compound:CPD-1774
metacycM:CPD-1774
4-methylene-L-glutamate
CHEBI:17299
chebi:17299
4-methylene-L-glutamate(2-)
(2S)-2-amino-4-methylenepentanedioate
(2S)-2-amino-4-methylidenepentanedioate
CHEBI:48031
chebi:48031
4-methylene-L-glutamic acid
(2S)-2-amino-4-methylidenepentanedioic acid
4-Methylene-L-glutamate
4-methylidene-L-glutamic acid
chebi:12026
chebi:1899
chebi:20444
chebi:20445
keggC:M_C00651
seedM:M_cpd00495
secondary/obsolete/fantasy identifier