Feedback

4-sulfobenzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2088Image of MNXM2088
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC7H4O5S
charge-2
mass200.16966
referencechebi:20476
InChIKeyHWAQOZGATRIYQG-UHFFFAOYSA-L
InChIInChI=1S/C7H6O5S/c8-7(9)5-1-3-6(4-2-5)13(10,11)12/h1-4H,(H,8,9)(H,10,11,12)/p-2
SMILES[O-]C(=O)c1ccc(cc1)S([O-])(=O)=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:20476
chebi:20476
4-sulfobenzoate
(-)O3S-C6H4-COO(-)
4-sulfonatobenzoate
4-sulfonatobenzoate(2-)
4-sulphonatobenzoate
envipath:...c573cd98c66f
envipathM:...c573cd98c66f
4-Sulfobenzoate
kegg.compound:C02236
keggC:C02236
4-Sulfobenzoate
4-Sulfobenzoic acid
seed.compound:cpd01511
seedM:cpd01511
4-Sulfobenzoate
4-Sulfobenzoic acid
4-sulfobenzoate
metacyc.compound:CPD-257
metacycM:CPD-257
4-sulfobenzoate
CHEBI:16309
chebi:16309
4-sulfobenzoate(1-)
4-sulfobenzoate
4-sulphobenzoate
HO3S-C6H4-COO(-)
CHEBI:30789
chebi:30789
4-sulfobenzoic acid
4-Sulfobenzoic acid
4-sulphobenzoic acid
HO3S-C6H4-COOH
p-sulfobenzoic acid
para-sulfobenzoic acid
chebi:12045
chebi:1936
chebi:20477
keggC:M_C02236
seedM:M_cpd01511
secondary/obsolete/fantasy identifier