Feedback

6-methylsalicylate

PropertiesImageOccurences in reactions
MNX_IDMNXM2093Image of MNXM2093
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 0
formulaC8H7O3
charge-1
mass151.13938
referencechebi:36658
InChIKeyHCJMNOSIAGSZBM-UHFFFAOYSA-M
InChIInChI=1S/C8H8O3/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4,9H,1H3,(H,10,11)/p-1
SMILESCc1cccc(O)c1C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:36658
chebi:36658
6-methylsalicylate
2,6-cresotate
2-hydroxy-6-methylbenzoate
6-Methyl 2-hydroxybenzenecarboxylate
6-Methylsalicylate
6-hydroxy-o-toluate
seed.compound:cpd01728
seedM:cpd01728
6-Methylsalicylate
2-Hydroxy-6-methylbenzoic acid
6-Methyl 2-hydroxybenzenecarboxylate
6-Methyl-2-hydroxybenzenecarboxylate
6-Methylsalicylic acid
6-methylsalicylate
Methylsalicylic acid
kegg.compound:C02657
keggC:C02657
6-Methylsalicylate
2-Hydroxy-6-methylbenzoic acid
6-Methyl-2-hydroxybenzenecarboxylate
6-Methylsalicylic acid
lipidmaps:LMPK13010002
lipidmapsM:LMPK13010002
6-Methylsalicylic acid
metacyc.compound:CPD-637
metacycM:CPD-637
6-methylsalicylate
6-Methyl 2-hydroxybenzenecarboxylate
Methylsalicylic acid
CHEBI:17637
chebi:17637
6-methylsalicylic acid
2,6-Cresotic acid
2-Hydroxy-6-methylbenzoic acid
2-Hydroxymethylbenzoic acid
2-hydroxy-6-methylbenzoic acid
6-Hydroxy-o-toluic acid
6-Methyl-2-hydroxybenzenecarboxylate
6-Methylsalicylic acid
Methylsalicylic acid
chebi:1165
chebi:12224
chebi:19648
chebi:19649
chebi:20743
chebi:2218
chebi:28178
keggC:M_C02657
seedM:M_cpd01728
secondary/obsolete/fantasy identifier