Feedback

D-cysteine

Properties
MNX_IDMNXM2112
formulaC3H7NO2S
charge0
mass121.15922
referencechebi:35236
Image of MNXM2112
InChIKeyXUJNEKJLAYXESH-UWTATZPHSA-N
InChIInChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m1/s1
SMILES[NH3+][C@H](CS)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref12
Distinct compatimentalized reactions in models6

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd00587 D-Cysteine
D-Amino-3-mercaptopropionic acid
D-cysteine
cys-D
chebi:32450 D-cysteinate(2-)
(2S)-2-amino-3-sulfidopropanoate
D-cysteinate
D-cysteine dianion
chebi:16375 D-cysteine
(2S)-2-amino-3-mercaptopropanoic acid
(2S)-2-amino-3-sulfanylpropanoic acid
(S)-2-amino-3-mercaptopropanoic acid
D-Amino-3-mercaptopropionic acid
D-CYSTEINE
D-Cystein
D-Cysteine
D-Zystein
DCY
keggC:C00793 D-Cysteine
D-Amino-3-mercaptopropionic acid
chebi:32451 D-cysteinium
(1S)-1-carboxy-2-mercaptoethanaminium
(1S)-1-carboxy-2-sulfanylethanaminium
D-cysteine cation
chebi:35236 D-cysteine
(2S)-2-ammonio-3-mercaptopropanoate
(2S)-2-ammonio-3-sulfanylpropanoate
D-cysteine zwitterion
chebi:32449 D-cysteinate(1-)
(2S)-2-amino-3-mercaptopropanoate
(2S)-2-amino-3-sulfanylpropanoate
D-cysteine monoanion
hydrogen D-cysteinate
hmdb:HMDB0003417 D-Cysteine
(2S)-2-amino-3-Mercaptopropanoate
(2S)-2-amino-3-Mercaptopropanoic acid
(2S)-2-amino-3-Sulfanylpropanoate
(2S)-2-amino-3-Sulfanylpropanoic acid
(2S)-2-amino-3-Sulphanylpropanoate
(2S)-2-amino-3-Sulphanylpropanoic acid
(2S)-2-amino-3-sulfanylpropanoic acid
(S)-2-amino-3-Mercaptopropanoate
(S)-2-amino-3-Mercaptopropanoic acid
D-Cystein
D-Zystein
D-amino-3-Mercaptopropionate
D-amino-3-Mercaptopropionic acid
DCY
L cysteine
biggM:cys__D D-Cysteine
biggM:M_cys__D
chebi:12919
chebi:20921
chebi:4111
chebi:41887
hmdb:HMDB03417
keggC:M_C00793
seedM:M_cpd00587
secondary/obsolete/fantasy identifier
metacycM:D-CYSTEINE D-cysteine