Feedback

D-cysteine

PropertiesImageOccurences in reactions
MNX_IDMNXM2112Image of MNXM2112
#reac
in my sandbox 0
in MNXref (generic)12
in models (compartimentalized) 6
formulaC3H7NO2S
charge0
mass121.15922
referencechebi:35236
InChIKeyXUJNEKJLAYXESH-UWTATZPHSA-N
InChIInChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m1/s1
SMILES[NH3+][C@H](CS)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:35236
chebi:35236
D-cysteine
(2S)-2-ammonio-3-mercaptopropanoate
(2S)-2-ammonio-3-sulfanylpropanoate
D-cysteine zwitterion
bigg.metabolite:cys__D
biggM:cys__D
D-Cysteine
hmdb:HMDB0003417 D-Cysteine
(2S)-2-amino-3-Mercaptopropanoate
(2S)-2-amino-3-Mercaptopropanoic acid
(2S)-2-amino-3-Sulfanylpropanoate
(2S)-2-amino-3-Sulfanylpropanoic acid
(2S)-2-amino-3-Sulphanylpropanoate
(2S)-2-amino-3-Sulphanylpropanoic acid
(2S)-2-amino-3-sulfanylpropanoic acid
(S)-2-amino-3-Mercaptopropanoate
(S)-2-amino-3-Mercaptopropanoic acid
D-Cystein
D-Zystein
D-amino-3-Mercaptopropionate
D-amino-3-Mercaptopropionic acid
DCY
L cysteine
kegg.compound:C00793
keggC:C00793
D-Cysteine
D-Amino-3-mercaptopropionic acid
seed.compound:cpd00587
seedM:cpd00587
D-Cysteine
D-Amino-3-mercaptopropionic acid
D-cysteine
cys-D
CHEBI:32449
chebi:32449
D-cysteinate(1-)
(2S)-2-amino-3-mercaptopropanoate
(2S)-2-amino-3-sulfanylpropanoate
D-cysteine monoanion
hydrogen D-cysteinate
CHEBI:32450
chebi:32450
D-cysteinate(2-)
(2S)-2-amino-3-sulfidopropanoate
D-cysteinate
D-cysteine dianion
metacyc.compound:D-CYSTEINE
metacycM:D-CYSTEINE
D-cysteine
CHEBI:16375
chebi:16375
D-cysteine
(2S)-2-amino-3-mercaptopropanoic acid
(2S)-2-amino-3-sulfanylpropanoic acid
(S)-2-amino-3-mercaptopropanoic acid
D-Amino-3-mercaptopropionic acid
D-CYSTEINE
D-Cystein
D-Cysteine
D-Zystein
DCY
CHEBI:32451
chebi:32451
D-cysteinium
(1S)-1-carboxy-2-mercaptoethanaminium
(1S)-1-carboxy-2-sulfanylethanaminium
D-cysteine cation
hmdb:HMDB03417
chebi:12919
chebi:20921
chebi:4111
chebi:41887
biggM:M_cys__D
keggC:M_C00793
seedM:M_cpd00587
secondary/obsolete/fantasy identifier