Feedback

 

D-cysteine zwitterion

Image of MNXM2112
Properties
MNX_IDMNXM2112
formulaC3H7NO2S
charge0
mass121.158
referencechebi:35236
InChIKeyXUJNEKJLAYXESH-UWTATZPHSA-N
InChIInChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m1/s1
SMILES[NH3+][C@H](CS)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of D-cysteine zwitterion in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:cys__D D-Cysteine
chebi:12919
chebi:16375
chebi:20921
chebi:4111
chebi:41887
(2S)-2-amino-3-mercaptopropanoic acid
(2S)-2-amino-3-sulfanylpropanoic acid
(S)-2-amino-3-mercaptopropanoic acid
D-Amino-3-mercaptopropionic acid
D-CYSTEINE
D-Cystein
D-Cysteine
D-Zystein
D-cysteine
DCY
XUJNEKJLAYXESH-UWTATZPHSA-N
chebi:32449 (2S)-2-amino-3-mercaptopropanoate
(2S)-2-amino-3-sulfanylpropanoate
D-cysteinate(1-)
D-cysteine monoanion
XUJNEKJLAYXESH-UWTATZPHSA-M
hydrogen D-cysteinate
chebi:32450 (2S)-2-amino-3-sulfidopropanoate
D-cysteinate
D-cysteinate(2-)
D-cysteine dianion
XUJNEKJLAYXESH-UWTATZPHSA-L
chebi:32451 (1S)-1-carboxy-2-mercaptoethanaminium
(1S)-1-carboxy-2-sulfanylethanaminium
D-cysteine cation
D-cysteinium
XUJNEKJLAYXESH-UWTATZPHSA-O
chebi:35236 (2S)-2-ammonio-3-mercaptopropanoate
(2S)-2-ammonio-3-sulfanylpropanoate
D-cysteine zwitterion
XUJNEKJLAYXESH-UWTATZPHSA-N
hmdb:HMDB03417 (2S)-2-amino-3-sulfanylpropanoic acid
D-Cysteine
L cysteine
kegg:C00793 D-Amino-3-mercaptopropionic acid
D-Cysteine
metacyc:D-CYSTEINE D-CYSTEINE
D-cysteine
seed:cpd00587 D-Amino-3-mercaptopropionic acid
D-Cysteine
cys-D