Feedback

2-aminomalonate semialdehyde

PropertiesImageOccurences in reactions
MNX_IDMNXM2124Image of MNXM2124
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 5
formulaC3H5NO3
charge0
mass103.07674
referencechebi:77662
InChIKeyXMTCKNXTTXDPJX-REOHCLBHSA-N
InChIInChI=1S/C3H5NO3/c4-2(1-5)3(6)7/h1-2H,4H2,(H,6,7)/t2-/m0/s1
SMILES[NH3+][C@@H](C=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:77662
chebi:77662
2-aminomalonate semialdehyde
(2S)-2-ammonio-3-oxopropanoate
(2S)-2-azaniumyl-3-oxopropanoate
L-3-oxoalanine zwitterion
bigg.metabolite:2amsa
biggM:2amsa
2-Aminomalonate semialdehyde
kegg.compound:C11822
keggC:C11822
2-Aminomalonate semialdehyde
2-Ammoniomalonate semialdehyde
seed.compound:cpd08626
seedM:cpd08626
2-Aminomalonate semialdehyde
2-Ammoniomalonate semialdehyde
2-aminomalonate semialdehyde
2-aminomalonate-semialdehyde
2amsa
3-oxo-L-alanine
Calpha-formylglycine
FGly
hmdb:HMDB0011602 3-Oxoalanine
2-Formylglycine
2-amino-3-Oxopropanoic acid
2-amino-3-oxo-Propanoate
2-amino-3-oxo-Propanoic acid
2-amino-3-oxopropanoic acid
3-oxo-(9CI)-alanine
3-oxo-L-Alanine
C(a)-Formylglycine
C(alpha)-Formylglycine
C(alpha)-formylglycine
C-Formylglycine
FGly
L-alpha-Formylglycine
a-Formylglycine
alpha-Formylglycine
alpha-formylglycine
amino-(8CI)malonaldehydic acid
metacyc.compound:2-AMINOMALONATE-SEMIALDEHYDE
metacycM:2-AMINOMALONATE-SEMIALDEHYDE
3-oxo-L-alanine
2-aminomalonate semialdehyde
Calpha-formylglycine
FGly
CHEBI:17740
chebi:17740
3-oxoalanine
2-amino-3-oxopropanoic acid
C(alpha)-formylglycine
C-formylglycine
FGly
alpha-formylglycine
sabiork.compound:21319
sabiorkM:21319
L-2-Amino-3-oxopropionate
L-2-Aminomalonate semialdehyde
CHEBI:58671
chebi:58671
L-3-oxoalaninate
(2S)-2-amino-3-oxopropanoate
3-oxo-L-alaninate
L-alpha-formylglycinate
CHEBI:37012
chebi:37012
L-3-oxoalanine
(2S)-2-amino-3-oxopropanoic acid
2-Aminomalonate semialdehyde
2-Ammoniomalonate semialdehyde
3-oxo-L-alanine
L-alpha-formylglycine
envipath:...2876a854bffa
envipathM:...2876a854bffa
compound 39544
envipath:...b4a32eb48adb
envipathM:...b4a32eb48adb
compound 39722
hmdb:HMDB11602
chebi:1020
chebi:11523
chebi:21210
biggM:M_2amsa
keggC:M_C11822
seedM:M_cpd08626
secondary/obsolete/fantasy identifier