Feedback

N,N-dihydroxy-L-tyrosine

PropertiesImageOccurences in reactions
MNX_IDMNXM2136Image of MNXM2136
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 0
formulaC9H10NO5
charge-1
mass212.17944
referencechebi:57270
InChIKeyQPHSFUGCBGILSS-QMMMGPOBSA-M
InChIInChI=1S/C9H11NO5/c11-7-3-1-6(2-4-7)5-8(9(12)13)10(14)15/h1-4,8,11,14-15H,5H2,(H,12,13)/p-1/t8-/m0/s1
SMILESON(O)[C@@H](Cc1ccc(O)cc1)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57270
chebi:57270
N,N-dihydroxy-L-tyrosine
(2S)-2-(dihydroxyamino)-3-(4-hydroxyphenyl)propanoate
N,N-dihydroxy-L-tyrosinate
kegg.compound:C15503
keggC:C15503
N,N-Dihydroxy-L-tyrosine
seed.compound:cpd11185
seedM:cpd11185
N,N-Dihydroxy-L-tyrosine
N,N-dihydroxy-L-tyrosine
metacyc.compound:CPD-7070
metacycM:CPD-7070
N,N-dihydroxy-L-tyrosine
CHEBI:12532
chebi:12532
N,N-dihydroxy-L-tyrosine
(2S)-2-(dihydroxyamino)-3-(4-hydroxyphenyl)propanoic acid
(S)-2-(dihydroxyamino)-3-(4-hydroxyphenyl)propionic acid
keggC:M_C15503
seedM:M_cpd11185
secondary/obsolete/fantasy identifier