Feedback

N-acetyl-L-aspartate

Properties
MNX_IDMNXM2139
formulaC6H7NO5
charge-2
mass173.12352
referencechebi:16953
Image of MNXM2139
InChIKeyOTCCIMWXFLJLIA-BYPYZUCNSA-L
InChIInChI=1S/C6H9NO5/c1-3(8)7-4(6(11)12)2-5(9)10/h4H,2H2,1H3,(H,7,8)(H,9,10)(H,11,12)/p-2/t4-/m0/s1
SMILESCC(=O)N[C@@H](CC([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref9
Distinct compatimentalized reactions in models5

Similar chemical compounds in external resources
IdentifierDescription
keggC:C01042 N-Acetyl-L-aspartate
N-Acetyl-L-aspartic acid
chebi:21547 N-acetyl-L-aspartic acid
(2S)-2-acetamidobutanedioic acid
(S)-2-(acetylamino)butanedioic acid
(S)-2-(acetylamino)succinic acid
L-N-acetylaspartic acid
N-acetylaspartic acid
NAA
acetyl-L-aspartic acid
acetylaspartic acid
biggM:Nacasp
sabiorkM:2224
N-Acetyl-L-aspartate
chebi:16953 N-acetyl-L-aspartate
(2S)-2-acetamidobutanedioate
(S)-2-(acetylamino)succinate
N-Acetyl-L-aspartate
N-acetyl-L-aspartate(2-)
seedM:cpd00767 N-Acetyl-L-aspartate
N-Acetyl-L-aspartic acid
N-acetyl-L-aspartate
N-acetyl-L-aspartic acid
N-acetyl-alpha-L-aspartate
metacycM:CPD-420 N-acetyl-L-aspartate
N-acetyl-L-aspartic acid
N-acetyl-alpha-L-aspartate
hmdb:HMDB0000812 N-Acetyl-L-aspartic acid
(2S)-2-Acetamidobutanedioate
(2S)-2-Acetamidobutanedioic acid
(2S)-2-acetamidobutanedioic acid
(S)-2-(acetylamino)Butanedioate
(S)-2-(acetylamino)Butanedioic acid
(S)-2-(acetylamino)Succinate
(S)-2-(acetylamino)Succinic acid
Acetyl-L-aspartate
Acetyl-L-aspartic acid
Acetylaspartate
Acetylaspartic acid
L-N-Acetylaspartate
L-N-Acetylaspartic acid
N-Acetyl aspartate
N-Acetyl-L-aspartate
N-Acetyl-S-aspartate
N-Acetyl-S-aspartic acid
N-Acetylaspartate
N-Acetylaspartate, monopotassium salt
N-Acetylaspartic acid
NAA
acetyl-L-aspartic acid
biggM:M_Nacasp
chebi:12574
chebi:21546
chebi:7149
chebi:87271
hmdb:HMDB00812
keggC:M_C01042
seedM:M_cpd00767
secondary/obsolete/fantasy identifier
MNXM163864is deprecated and replaced by this entry