Feedback

N-acetyl-L-aspartate

PropertiesImageOccurences in reactions
MNX_IDMNXM2139Image of MNXM2139
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 10
formulaC6H7NO5
charge-2
mass173.03352
referencechebi:16953
InChIKeyOTCCIMWXFLJLIA-BYPYZUCNSA-L
InChIInChI=1S/C6H9NO5/c1-3(8)7-4(6(11)12)2-5(9)10/h4H,2H2,1H3,(H,7,8)(H,9,10)(H,11,12)/p-2/t4-/m0/s1
SMILESCC(=O)N[C@@H](CC(=O)[O-])C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16953
chebi:16953
N-acetyl-L-aspartate
(2S)-2-acetamidobutanedioate
(S)-2-(acetylamino)succinate
N-Acetyl-L-aspartate
N-acetyl-L-aspartate(2-)
bigg.metabolite:Nacasp
biggM:Nacasp
sabiork.compound:2224
sabiorkM:2224
N-Acetyl-L-aspartate
kegg.compound:C01042
keggC:C01042
N-Acetyl-L-aspartate
N-Acetyl-L-aspartic acid
seed.compound:cpd00767
seedM:cpd00767
N-Acetyl-L-aspartate
N-Acetyl-L-aspartic acid
N-acetyl-L-aspartate
N-acetyl-L-aspartic acid
N-acetyl-alpha-L-aspartate
hmdb:HMDB0000812 N-Acetyl-L-aspartic acid
(2S)-2-Acetamidobutanedioate
(2S)-2-Acetamidobutanedioic acid
(2S)-2-acetamidobutanedioic acid
(S)-2-(Acetylamino)butanedioate
(S)-2-(Acetylamino)butanedioic acid
(S)-2-(Acetylamino)succinate
(S)-2-(Acetylamino)succinic acid
Acetyl aspartic acid
Acetyl-L-aspartate
Acetyl-L-aspartic acid
Acetylaspartate
Acetylaspartic acid
L-N-Acetylaspartate
L-N-Acetylaspartic acid
N-Acetyl aspartate
N-Acetyl-L-aspartate
N-Acetyl-S-aspartate
N-Acetyl-S-aspartic acid
N-Acetylaspartate
N-Acetylaspartate, monopotassium salt
N-Acetylaspartic acid
NAA
acetyl-L-aspartic acid
metacyc.compound:CPD-420
metacycM:CPD-420
N-acetyl-L-aspartate
N-acetyl-L-aspartic acid
N-acetyl-alpha-L-aspartate
CHEBI:176586
chebi:176586
N-acetyl-L-aspartic acid-1,2,3,4-(13)C4
(2S)-2-acetamido((13)C4)butanedioic acid
N-acetyl-L-((13)C4)aspartic acid
N-acetyl-L-aspartic acid-1,2,3,4-[(13)C4]
CHEBI:21547
chebi:21547
N-acetyl-L-aspartic acid
(2S)-2-acetamidobutanedioic acid
(S)-2-(acetylamino)butanedioic acid
(S)-2-(acetylamino)succinic acid
L-N-acetylaspartic acid
N-acetylaspartic acid
NAA
acetyl-L-aspartic acid
acetylaspartic acid
hmdb:HMDB00812
chebi:12574
chebi:21546
chebi:7149
chebi:87271
biggM:M_Nacasp
keggC:M_C01042
seedM:M_cpd00767
secondary/obsolete/fantasy identifier