Feedback

N-methyl-L-glutamate

PropertiesImageOccurences in reactions
MNX_IDMNXM2141Image of MNXM2141
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 0
formulaC6H10NO4
charge-1
mass160.14794
referencechebi:29083
InChIKeyXLBVNMSMFQMKEY-BYPYZUCNSA-M
InChIInChI=1S/C6H11NO4/c1-7-4(6(10)11)2-3-5(8)9/h4,7H,2-3H2,1H3,(H,8,9)(H,10,11)/p-1/t4-/m0/s1
SMILESC[NH2+][C@@H](CCC([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:29083
chebi:29083
N-methyl-L-glutamate
(2S)-2-(methylammonio)pentanedioate
N-methyl-L-glutamate(1-)
sabiork.compound:2227
sabiorkM:2227
kegg.compound:C01046
keggC:C01046
N-Methyl-L-glutamate
N-Methyl-L-glutamic acid
seed.compound:cpd00771
seedM:cpd00771
N-Methyl-L-glutamate
N-Methyl-L-glutamic acid
N-methyl-L-glutamate
N-methyl-L-glutamic acid
NMG
metacyc.compound:CPD-404
metacycM:CPD-404
N-methyl-L-glutamate
N-methyl-L-glutamic acid
NMG
hmdb:HMDB0062660 N-methyl-L-glutamic Acid
(2S)-2-(methylamino)Pentanedioate
(2S)-2-(methylamino)Pentanedioic acid
(2S)-2-(methylamino)pentanedioic acid
N-Methyl-D-glutamate
N-Methyl-L-glutamate
N-Methylglutamate
N-Methylglutamic acid
N-methyl-L-glutamic acid
CHEBI:16440
chebi:16440
N-methyl-L-glutamic acid
(2S)-2-(methylamino)pentanedioic acid
N-Methyl-L-glutamic acid
N-methylglutamic acid
hmdb:HMDB62660
chebi:12517
chebi:12605
chebi:21754
chebi:21755
chebi:7311
keggC:M_C01046
seedM:M_cpd00771
secondary/obsolete/fantasy identifier