Feedback

N-methyl-L-glutamate

Properties
MNX_IDMNXM2141
formulaC6H10NO4
charge-1
mass160.14794
referencechebi:29083
Image of MNXM2141
InChIKeyXLBVNMSMFQMKEY-BYPYZUCNSA-M
InChIInChI=1S/C6H11NO4/c1-7-4(6(10)11)2-3-5(8)9/h4,7H,2-3H2,1H3,(H,8,9)(H,10,11)/p-1/t4-/m0/s1
SMILESC[NH2+][C@@H](CCC([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd00771 N-Methyl-L-glutamate
N-Methyl-L-glutamic acid
N-methyl-L-glutamate
N-methyl-L-glutamic acid
NMG
metacycM:CPD-404 N-methyl-L-glutamate
N-methyl-L-glutamic acid
NMG
hmdb:HMDB0062660 N-methyl-L-glutamic Acid
(2S)-2-(methylamino)Pentanedioate
(2S)-2-(methylamino)Pentanedioic acid
(2S)-2-(methylamino)pentanedioic acid
N-Methyl-D-glutamate
N-Methyl-L-glutamate
N-Methylglutamate
N-Methylglutamic acid
N-methyl-L-glutamic acid
chebi:29083 N-methyl-L-glutamate
(2S)-2-(methylammonio)pentanedioate
N-methyl-L-glutamate(1-)
chebi:16440 N-methyl-L-glutamic acid
(2S)-2-(methylamino)pentanedioic acid
N-Methyl-L-glutamic acid
N-methylglutamic acid
chebi:12517
chebi:12605
chebi:21754
chebi:21755
chebi:7311
hmdb:HMDB62660
keggC:M_C01046
seedM:M_cpd00771
secondary/obsolete/fantasy identifier
keggC:C01046
sabiorkM:2227
N-Methyl-L-glutamate
N-Methyl-L-glutamic acid