Feedback

oxomalonate

Properties
MNX_IDMNXM2147
formulaC3O5
charge-2
mass116.0291
referencechebi:17121
Image of MNXM2147
InChIKeyXEEVLJKYYUVTRC-UHFFFAOYSA-L
InChIInChI=1S/C3H2O5/c4-1(2(5)6)3(7)8/h(H,5,6)(H,7,8)/p-2
SMILES[O-]C(=O)C(=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB0031522 Mesoxalic acid
2-Oxomalonic acid
2-Oxopropanedioic acid
2-oxopropanedioic acid
ALPHA-KETOMALONIC ACID
Ketomalonate
Ketomalonic acid
Mesoxalate
Mesoxalic acid, 8ci
Oxomalonate
Oxomalonic acid
Propanedioic acid, oxo- (9ci)
a-KETOMALONate
a-KETOMALONic acid
alpha-KETOMALONate
alpha-ketomalonate
alpha-ketomalonic acid
mesoxalic acid
chebi:30843 oxomalonate(1-)
carboxy(oxo)acetate
envipath:...29a5511f6b50 compound 1022
metacycM:OXOMALONATE oxomalonate
ketomalonic acid
mesoxalic acid
oxomalonic acid
seedM:cpd00619 Oxomalonate
Ketomalonic acid
Mesoxalic acid
Oxomalonic acid
ketomalonic acid
mesoxalic acid
oxomalonate
oxomalonic acid
envipath:...e1fefb5f54c9 compound 38011
chebi:17121 oxomalonate
oxomalonate(2-)
oxopropanedioate
chebi:30842 oxomalonic acid
ALPHA-KETOMALONIC ACID
Ketomalonic acid
Mesoxalic acid
Oxomalonic acid
oxopropanedioic acid
keggC:C00830
sabiorkM:2169
Oxomalonate
Ketomalonic acid
Mesoxalic acid
Oxomalonic acid
chebi:14727
chebi:25792
chebi:25793
chebi:43846
chebi:7850
hmdb:HMDB31522
keggC:M_C00830
seedM:M_cpd00619
secondary/obsolete/fantasy identifier
MNXM531764is deprecated and replaced by this entry
MNXM723722is deprecated and replaced by this entry
MNXM724014is deprecated and replaced by this entry