Feedback

oxomalonate

PropertiesImageOccurences in reactions
MNX_IDMNXM2147Image of MNXM2147
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC3O5
charge-2
mass115.97567
referencechebi:17121
InChIKeyXEEVLJKYYUVTRC-UHFFFAOYSA-L
InChIInChI=1S/C3H2O5/c4-1(2(5)6)3(7)8/h(H,5,6)(H,7,8)/p-2
SMILESO=C([O-])C(=O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17121
chebi:17121
oxomalonate
oxomalonate(2-)
oxopropanedioate
hmdb:HMDB0031522 Mesoxalic acid
2-Oxomalonic acid
2-Oxopropanedioic acid
2-oxopropanedioic acid
ALPHA-KETOMALONIC ACID
Ketomalonate
Ketomalonic acid
Mesoxalate
Mesoxalic acid, 8ci
Oxomalonate
Oxomalonic acid
Propanedioic acid, oxo- (9ci)
a-KETOMALONate
a-KETOMALONic acid
alpha-KETOMALONate
alpha-ketomalonate
alpha-ketomalonic acid
mesoxalic acid
sabiork.compound:2169
sabiorkM:2169
kegg.compound:C00830
keggC:C00830
Oxomalonate
Ketomalonic acid
Mesoxalic acid
Oxomalonic acid
seed.compound:cpd00619
seedM:cpd00619
Oxomalonate
Ketomalonic acid
Mesoxalic acid
Oxomalonic acid
ketomalonic acid
mesoxalic acid
oxomalonate
oxomalonic acid
envipath:...29a5511f6b50
envipathM:...29a5511f6b50
compound 1022
envipath:...e1fefb5f54c9
envipathM:...e1fefb5f54c9
compound 38011
CHEBI:30843
chebi:30843
oxomalonate(1-)
carboxy(oxo)acetate
metacyc.compound:OXOMALONATE
metacycM:OXOMALONATE
oxomalonate
ketomalonic acid
mesoxalic acid
oxomalonic acid
CHEBI:30842
chebi:30842
oxomalonic acid
ALPHA-KETOMALONIC ACID
Ketomalonic acid
Mesoxalic acid
Oxomalonic acid
oxopropanedioic acid
hmdb:HMDB31522
chebi:14727
chebi:25792
chebi:25793
chebi:43846
chebi:7850
keggC:M_C00830
seedM:M_cpd00619
secondary/obsolete/fantasy identifier