Feedback

coelenterazine h

PropertiesImageOccurences in reactions
MNX_IDMNXM2155Image of MNXM2155
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 0
formulaC26H21N3O2
charge0
mass407.46396
referencechebi:16531
InChIKeyKAEGGIFPLJZUOZ-UHFFFAOYSA-N
InChIInChI=1S/C26H21N3O2/c30-21-13-11-20(12-14-21)24-17-29-25(22(27-24)15-18-7-3-1-4-8-18)28-23(26(29)31)16-19-9-5-2-6-10-19/h1-14,17,27,30H,15-16H2
SMILESOc1ccc(cc1)-c1cn2c(nc(Cc3ccccc3)c2=O)c(Cc2ccccc2)[nH]1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16531
chebi:16531
coelenterazine h
2,8-dibenzyl-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3(7H)-one
Renilla luciferin
renillluciferin
kegg.compound:C00982
keggC:C00982
Renilla luciferin
2,8-Dibenzyl-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3(7H)-one
Coelenterazine h
seed.compound:cpd00723
seedM:cpd00723
Renilla luciferin
2,8-dibenzyl-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3(7H)-one
2-deoxycoelenterazine
coelenterazine h
renilla luciferin
metacyc.compound:RENILLA-LUCIFERIN
metacycM:RENILLA-LUCIFERIN
coelenterazine h
2,8-dibenzyl-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3(7H)-one
2-deoxycoelenterazine
Renilla luciferin
chebi:12732
chebi:22006
chebi:8804
keggC:M_C00982
seedM:M_cpd00723
secondary/obsolete/fantasy identifier