Feedback

(2-hydroxyphenyl)acetate

PropertiesImageOccurences in reactions
MNX_IDMNXM2160Image of MNXM2160
#reac
in my sandbox 0
in MNXref (generic)19
in models (compartimentalized) 8
formulaC8H7O3
charge-1
mass151.04007
referencechebi:62423
InChIKeyCCVYRRGZDBSHFU-UHFFFAOYSA-M
InChIInChI=1S/C8H8O3/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4,9H,5H2,(H,10,11)/p-1
SMILESO=C([O-])Cc1ccccc1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:62423
chebi:62423
(2-hydroxyphenyl)acetate
2-hydroxybenzeneacetic acid (1-)
2-hydroxyphenylacetate
o-hydroxyphenylacetate
metacyc.compound:CPD-11495
metacycM:CPD-11495
(2-hydroxyphenyl)acetate
(2-hydroxybenzene)acetic acid
(2-hydroxyphenyl)acetic acid
(o-hydroxyphenyl)acetate
(o-hydroxyphenyl)acetic acid
CHEBI:28478
chebi:28478
(2-hydroxyphenyl)acetic acid
(o-hydroxyphenyl)acetic acid
2'-hydroxyphenylacetic acid
2-hydroxybenzeneacetic acid
2-hydroxyphenylacetic acid
o-hydroxyphenylacetic acid
bigg.metabolite:2hyoxplac
biggM:2hyoxplac
sabiork.compound:8207
sabiorkM:8207
envipath:...efd701ffc363
envipathM:...efd701ffc363
2-Hydroxyphenylacetate
seed.compound:cpd03480
seedM:cpd03480
2-Hydroxyphenylacetate
(2-hydroxybenzene)acetic acid
(2-hydroxyphenyl)acetate
(2-hydroxyphenyl)acetic acid
(o-hydroxyphenyl)acetate
(o-hydroxyphenyl)acetic acid
2-Hydroxyphenylacetic acid
2-hydroxybenzeneacetic acid
2-hydroxyphenylacetate
2-hydroxyphenylacetic acid
acetic acid, (o-hydroxyphenyl)-
benzeneacetic acid, 2-hydroxy-
o-hydroxy phenylacetic acid
o-hydroxyphenylacetate
o-hydroxyphenylacetic acid
kegg.compound:C05852
keggC:C05852
2-Hydroxyphenylacetate
2-Hydroxyphenylacetic acid
hmdb:HMDB0000669 ortho-Hydroxyphenylacetic acid
(2-Hydroxyphenyl)acetate
(2-Hydroxyphenyl)acetic acid
(O-Hydroxyphenyl)-acetate
(O-Hydroxyphenyl)-acetic acid
(O-Hydroxyphenyl)acetate
(O-Hydroxyphenyl)acetic acid
2'-Hydroxyphenylacetate
2'-Hydroxyphenylacetic acid
2-(2-hydroxyphenyl)acetic acid
2-HPAA
2-Hydroxybenzeneacetate
2-Hydroxybenzeneacetic acid
2-Hydroxyphenylacetate
2-Hydroxyphenylacetic acid
Hydroxyphenylacetate
Hydroxyphenylacetic acid
O-Hydroxyphenyl acetic acid
O-Hydroxyphenylacetate
O-Hydroxyphenylacetic acid
Ortho-hydroxyphenylacetate
Ortho-hydroxyphenylacetic acid
o-hydroxyphenylacetic acid
hmdb:HMDB00669
chebi:1169
chebi:19655
biggM:M_2hyoxplac
keggC:M_C05852
seedM:M_cpd03480
secondary/obsolete/fantasy identifier