Feedback

(2-hydroxyphenyl)acetate

Properties
MNX_IDMNXM2160
formulaC8H7O3
charge-1
mass151.13938
referencechebi:62423
Image of MNXM2160
InChIKeyCCVYRRGZDBSHFU-UHFFFAOYSA-M
InChIInChI=1S/C8H8O3/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4,9H,5H2,(H,10,11)/p-1
SMILESOc1ccccc1CC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref19
Distinct compatimentalized reactions in models6

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd03480 2-Hydroxyphenylacetate
(2-hydroxybenzene)acetic acid
(2-hydroxyphenyl)acetate
(2-hydroxyphenyl)acetic acid
(o-hydroxyphenyl)acetate
(o-hydroxyphenyl)acetic acid
2-Hydroxyphenylacetic acid
2-hydroxybenzeneacetic acid
2-hydroxyphenylacetate
2-hydroxyphenylacetic acid
acetic acid, (o-hydroxyphenyl)-
benzeneacetic acid, 2-hydroxy-
o-hydroxy phenylacetic acid
o-hydroxyphenylacetate
o-hydroxyphenylacetic acid
metacycM:CPD-11495 (2-hydroxyphenyl)acetate
(2-hydroxybenzene)acetic acid
(2-hydroxyphenyl)acetic acid
(o-hydroxyphenyl)acetate
(o-hydroxyphenyl)acetic acid
chebi:28478 (2-hydroxyphenyl)acetic acid
(o-hydroxyphenyl)acetic acid
2'-hydroxyphenylacetic acid
2-hydroxybenzeneacetic acid
2-hydroxyphenylacetic acid
o-hydroxyphenylacetic acid
hmdb:HMDB0000669 Ortho-Hydroxyphenylacetic acid
(2-Hydroxyphenyl)acetate
(2-Hydroxyphenyl)acetic acid
(O-Hydroxyphenyl)-acetate
(O-Hydroxyphenyl)-acetic acid
(O-Hydroxyphenyl)acetate
(O-Hydroxyphenyl)acetic acid
2'-Hydroxyphenylacetate
2'-Hydroxyphenylacetic acid
2-(2-hydroxyphenyl)acetic acid
2-HPAA
2-Hydroxybenzeneacetate
2-Hydroxybenzeneacetic acid
2-Hydroxyphenylacetate
2-Hydroxyphenylacetic acid
Hydroxyphenylacetate
Hydroxyphenylacetic acid
O-Hydroxyphenyl acetic acid
O-Hydroxyphenylacetate
O-Hydroxyphenylacetic acid
o-hydroxyphenylacetic acid
ortho-Hydroxyphenylacetate
chebi:62423 (2-hydroxyphenyl)acetate
2-hydroxybenzeneacetic acid (1-)
2-hydroxyphenylacetate
o-hydroxyphenylacetate
biggM:2hyoxplac
envipath:...efd701ffc363
sabiorkM:8207
2-Hydroxyphenylacetate
biggM:M_2hyoxplac
chebi:1169
chebi:19655
hmdb:HMDB00669
keggC:M_C05852
seedM:M_cpd03480
secondary/obsolete/fantasy identifier
keggC:C05852 2-Hydroxyphenylacetate
2-Hydroxyphenylacetic acid
MNXM588546is deprecated and replaced by this entry