Feedback

(R)-2-hydroxypropyl-coenzyme M

PropertiesImageOccurences in reactions
MNX_IDMNXM2164Image of MNXM2164
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC5H11O4S2
charge-1
mass199.27044
referencechebi:58458
InChIKeyQWNJCCLFGYAGRK-RXMQYKEDSA-M
InChIInChI=1S/C5H12O4S2/c1-5(6)4-10-2-3-11(7,8)9/h5-6H,2-4H2,1H3,(H,7,8,9)/p-1/t5-/m1/s1
SMILESC[C@@H](O)CSCCS([O-])(=O)=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58458
chebi:58458
(R)-2-hydroxypropyl-coenzyme M
(R)-2-hydroxypropyl-CoM(1-)
2-{[(2R)-2-hydroxypropyl]sulfanyl}ethanesulfonate
envipath:...da32f18caf6e
envipathM:...da32f18caf6e
(R)-2-Hydroxypropyl-CoM
kegg.compound:C11496
keggC:C11496
(R)-2-Hydroxypropyl-CoM
2-(R)-Hydroxypropyl-CoM
CHEBI:18354
chebi:18354
(R)-2-hydroxypropyl-CoM
(R)-2-Hydroxypropyl-CoM
2-(R)-Hydroxypropyl-CoM
2-{[(2R)-2-hydroxypropyl]sulfanyl}ethanesulfonic acid
seed.compound:cpd08335
seedM:cpd08335
2-(R)-Hydroxypropyl-CoM
(R)-2-Hydroxypropyl-CoM
2-(R)-hydroxypropyl-CoM
metacyc.compound:2-R-HYDROXYPROPYL-COM
metacycM:2-R-HYDROXYPROPYL-COM
2-(R)-hydroxypropyl-CoM
chebi:11470
chebi:18652
chebi:311
keggC:M_C11496
seedM:M_cpd08335
secondary/obsolete/fantasy identifier