Feedback

1,4,5,6-tetrahydro-6-oxonicotinate

PropertiesImageOccurences in reactions
MNX_IDMNXM2168Image of MNXM2168
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 0
formulaC6H6NO3
charge-1
mass140.11678
referencechebi:57777
InChIKeySDKCWSUZEUBWLP-UHFFFAOYSA-M
InChIInChI=1S/C6H7NO3/c8-5-2-1-4(3-7-5)6(9)10/h3H,1-2H2,(H,7,8)(H,9,10)/p-1
SMILES[O-]C(=O)C1=CNC(=O)CC1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57777
chebi:57777
1,4,5,6-tetrahydro-6-oxonicotinate
1,4,5,6-tetrahydro-6-oxonicotinate anion
6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate
seed.compound:cpd02598
seedM:cpd02598
1,4,5,6-Tetrahydro-6-oxonicotinate
1,4,5,6-Tetrahydro-6-oxonicotinic acid
1,4,5,6-tetrahydro-6-oxonicotinate
6-Oxo-1,4,5,6-tetrahydronicotinate
6-oxo-1,4,5,6-tetrahydronicotinate
sabiork.compound:7167
sabiorkM:7167
1,4,5,6-Tetrahydro-6-oxonicotinate
THON
CHEBI:16453
chebi:16453
1,4,5,6-tetrahydro-6-oxonicotinic acid
1,4,5,6-Tetrahydro-6-oxonicotinate
1,4,5,6-Tetrahydro-6-oxonicotinic acid
6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylic acid
kegg.compound:C04226
keggC:C04226
6-Oxo-1,4,5,6-tetrahydronicotinate
1,4,5,6-Tetrahydro-6-oxonicotinate
1,4,5,6-Tetrahydro-6-oxonicotinic acid
metacyc.compound:CPD-283
metacycM:CPD-283
6-oxo-1,4,5,6-tetrahydronicotinate
1,4,5,6-tetrahydro-6-oxonicotinate
chebi:11168
chebi:18925
chebi:533
keggC:M_C04226
seedM:M_cpd02598
secondary/obsolete/fantasy identifier