Feedback

2-dehydro-L-idonate

PropertiesImageOccurences in reactions
MNX_IDMNXM2177Image of MNXM2177
#reac
in my sandbox 0
in MNXref (generic)10
in models (compartimentalized) 0
formulaC6H9O7
charge-1
mass193.13146
referencechebi:36602
InChIKeyVBUYCZFBVCCYFD-NUNKFHFFSA-M
InChIInChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-4,7-10H,1H2,(H,12,13)/p-1/t2-,3+,4-/m0/s1
SMILESOC[C@H](O)[C@@H](O)[C@H](O)C(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:36602
chebi:36602
2-dehydro-L-idonate
2-Dehydro-L-idonate
2-Keto-L-gulonate
2-Oxo-L-gulonate
L-Sorbosonate
L-sorbosonate
L-xylo-hex-2-ulosonate
sabiork.compound:2527
sabiorkM:2527
2-Dehydro-L-idonate
2,5-Didehydro-D-gluconate
2,5-Diketogluconic acid
kegg.compound:C15673
keggC:C15673
2-Dehydro-L-idonate
2-Dehydro-L-idonic acid
2-Keto-L-gulonate
2-Keto-L-gulonic acid
L-Ketoidonate
L-Ketoidonic acid
L-Sorbosonate
L-Sorbosonic acid
L-xylo-Hex-2-ulosonic acid
CHEBI:19543
chebi:19543
2-dehydro-L-idonic acid
2-Dehydro-L-idonic acid
2-Keto-L-gulonate
2-Keto-L-gulonic acid
2-Oxo-l-gulonic acid
3-keto-L-Gulonic acid
L-Ketoidonate
L-Ketoidonic acid
L-Sorbosonate
L-Sorbosonic acid
L-Xylohexulosonic acid
L-sorbosonic acid
L-xylo-2-Hexulosonic acid
L-xylo-Hex-2-ulosonic acid
L-xylo-hex-2-ulosonic acid
metacyc.compound:CPD-13059
metacycM:CPD-13059
2-keto-L-gulonate
2-dehydro-L-gulonate
2-dehydro-L-idonate
2-keto-L-idonate
2-oxo-L-gulonate
2oxo-L-idonate
L-sorbosonate
L-xylo-2-hex-2-ulosonate
L-xylo-2-hexulosonate
seed.compound:cpd11314
seedM:cpd11314
L-Sorbosonate
2-Dehydro-L-gulonate
2-Dehydro-L-idonate
2-Dehydro-L-idonic acid
2-Keto-L-gulonate
2-Keto-L-gulonic acid
2-dehydro-L-gulonate
2-dehydro-L-idonate
2-keto-L-gulonate
2-keto-L-idonate
2-oxo-L-gulonate
2oxo-L-idonate
L-Ketoidonate
L-Ketoidonic acid
L-Sorbosonic acid
L-sorbosonate
L-xylo-2-hex-2-ulosonate
L-xylo-2-hexulosonate
L-xylo-Hex-2-ulosonic acid
keggC:M_C15673
seedM:M_cpd11314
secondary/obsolete/fantasy identifier