Feedback

2-hydroxychromene-2-carboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM2181Image of MNXM2181
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC10H7O4
charge-1
mass191.16018
referencechebi:59350
InChIKeyLGYIZQLNYONEFJ-UHFFFAOYSA-M
InChIInChI=1S/C10H8O4/c11-9(12)10(13)6-5-7-3-1-2-4-8(7)14-10/h1-6,13H,(H,11,12)/p-1
SMILESOC1(Oc2ccccc2C=C1)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:59350
chebi:59350
2-hydroxychromene-2-carboxylate
2-hydroxy-2H-chromene-2-carboxylate
sabiork.compound:8458
sabiorkM:8458
envipath:...1aba836fd30c
envipathM:...1aba836fd30c
2-Hydroxychromene-2-carboxylate
kegg.compound:C06204
keggC:C06204
2-Hydroxychromene-2-carboxylate
2-Hydroxy-2H-chromene-2-carboxylate
seed.compound:cpd03711
seedM:cpd03711
2-Hydroxychromene-2-carboxylate
2-Hydroxy-2H-chromene-2-carboxylate
2-hydroxy-2H-chromene-2-carboxylate
2-hydroxychromene-2-carboxylate
HCCA
metacyc.compound:CPDN-384
metacycM:CPDN-384
2-hydroxychromene-2-carboxylate
2-hydroxy-2H-chromene-2-carboxylate
HCCA
CHEBI:28992
chebi:28992
2-hydroxychromene-2-carboxylic acid
2-Hydroxy-2H-chromene-2-carboxylate
2-hydroxy-2H-chromene-2-carboxylic acid
chebi:1150
chebi:19632
chebi:59351
keggC:M_C06204
seedM:M_cpd03711
secondary/obsolete/fantasy identifier