Feedback

3'-GMP

PropertiesImageOccurences in reactions
MNX_IDMNXM2183Image of MNXM2183
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 8
formulaC10H12N5O8P
charge-2
mass361.204941
referencechebi:60732
InChIKeyZDPUTNZENXVHJC-UUOKFMHZSA-L
InChIInChI=1S/C10H14N5O8P/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-5(17)6(3(1-16)22-9)23-24(19,20)21/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18)/p-2/t3-,5-,6-,9-/m1/s1
SMILESNc1nc2n(cnc2c(=O)[nH]1)[C@@H]1O[C@H](CO)[C@@H](OP([O-])([O-])=O)[C@H]1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:60732
chebi:60732
3'-GMP
3'-O-phosphonatoguanosine
guanosine 3'-diphosphate
guanosine 3'-monophosphate(2-)
seed.compound:cpd03701
seedM:cpd03701
Gp
3'-GMP
3'-Guanylic acid
3'-guanylic acid
3gmp
Guanosine 3'-phosphate
Guo-3'-P
guanosine 3'-monophosphate
guanosine 3'-phosphate
bigg.metabolite:3gmp
biggM:3gmp
Guanosine 3 phosphate
sabiork.compound:1857
sabiorkM:1857
kegg.compound:C06193
keggC:C06193
Guanosine 3'-phosphate
3'-GMP
3'-Guanylic acid
Gp
Guo-3'-P
CHEBI:28072
chebi:28072
guanosine 3'-monophosphate
3'-GMP
3'-Guanylic acid
3'-guanylic acid
GUANOSINE-3'-MONOPHOSPHATE
Gp
Guanosine 3'-phosphate
Guo-3'-P
metacyc.compound:CPD-3708
metacycM:CPD-3708
guanosine 3'-monophosphate
3'-GMP
3'-guanylic acid
guanosine 3'-phosphate
chebi:24447
chebi:39948
chebi:42888
chebi:5567
biggM:M_3gmp
keggC:M_C06193
seedM:M_cpd03701
secondary/obsolete/fantasy identifier