Feedback

3-chloro-cis,cis-muconate

PropertiesImageOccurences in reactions
MNX_IDMNXM2186Image of MNXM2186
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 0
formulaC6H3ClO4
charge-2
mass174.53832
referencechebi:17589
InChIKeyICMVYBXQDUXEEE-BXTBVDPRSA-L
InChIInChI=1S/C6H5ClO4/c7-4(3-6(10)11)1-2-5(8)9/h1-3H,(H,8,9)(H,10,11)/p-2/b2-1-,4-3+
SMILES[O-]C(=O)\C=C/C(/Cl)=C\C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17589
chebi:17589
3-chloro-cis,cis-muconate
(2E,4Z)-3-chlorohexa-2,4-dienedioate
3-chloro-cis,cis-muconate(2-)
sabiork.compound:6721
sabiorkM:6721
envipath:...19739675f945
envipathM:...19739675f945
3-Chloro-cis,cis-muconate
kegg.compound:C03585
keggC:C03585
3-Chloro-cis,cis-muconate
(2E,4Z)-3-Chlorohexa-2,4-dienedioate
seed.compound:cpd02254
seedM:cpd02254
3-Chloro-cis,cis-muconate
(2E,4Z)-3-chlorohexa-2,4-dienedioate
3-chloro-cis,cis-muconate
metacyc.compound:CPD-279
metacycM:CPD-279
3-chloro-cis,cis-muconate
(2E,4Z)-3-chlorohexa-2,4-dienedioate
CHEBI:1472
chebi:1472
lipidmaps:LMFA01090153
lipidmapsM:LMFA01090153
3-chloro-cis,cis-muconic acid
(2E,4Z)-3-chlorohexa-2,4-dienedioic acid
(E,Z)-3-chloro-2,4-hexadienedioic acid
3-Chloro-cis,cis-muconate
chebi:11768
chebi:19980
keggC:M_C03585
seedM:M_cpd02254
secondary/obsolete/fantasy identifier